(2R,3S,4R,5R)-2-((R)-hydroxy(1,2,3,4-tetrahydroisoquinolin-8-yl)methyl)-5-(4-methyl-7H-pyrrolo[2,3-d]pyrimidin-7-yl)tetrahydrofuran-3,4-diol

ID: ALA4517481

PubChem CID: 122497045

Max Phase: Preclinical

Molecular Formula: C21H24N4O4

Molecular Weight: 396.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ncnc2c1ccn2[C@@H]1O[C@H]([C@H](O)c2cccc3c2CNCC3)[C@@H](O)[C@H]1O

Standard InChI:  InChI=1S/C21H24N4O4/c1-11-13-6-8-25(20(13)24-10-23-11)21-18(28)17(27)19(29-21)16(26)14-4-2-3-12-5-7-22-9-15(12)14/h2-4,6,8,10,16-19,21-22,26-28H,5,7,9H2,1H3/t16-,17+,18-,19-,21-/m1/s1

Standard InChI Key:  IRRYGHOMAHMGTM-TWHPPBISSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   25.0399  -22.4534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3282  -22.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7449  -22.0309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5092  -22.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0206  -21.6827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5722  -20.9993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7839  -21.2147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7244  -23.1085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.8368  -21.7216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.8614  -20.2351    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.9215  -18.9137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4104  -19.5513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6859  -19.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6469  -20.0171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3314  -20.4560    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0554  -20.0820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0905  -19.2646    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.4052  -18.8293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4407  -18.0129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7374  -22.8442    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.0523  -23.2705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.9061  -21.2614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9204  -22.0807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6318  -22.4745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6073  -20.8438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3153  -21.2397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0084  -20.8269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9996  -20.0163    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.2915  -19.6203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5923  -20.0349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  1  1  0
  2  1  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  3  1  0
  4  8  1  6
  5  9  1  6
  6 10  1  1
 10 14  1  0
 13 11  1  0
 11 12  2  0
 12 10  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 18 19  1  0
  3 20  1  6
  1 21  1  6
  2 26  2  0
 25 22  2  0
 22 23  1  0
 23 24  2  0
 24  2  1  0
 25 26  1  0
 25 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4517481

    ---

Associated Targets(Human)

PRMT5 Tchem Protein arginine N-methyltransferase 5 (1273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 396.45Molecular Weight (Monoisotopic): 396.1798AlogP: 0.74#Rotatable Bonds: 3
Polar Surface Area: 112.66Molecular Species: BASEHBA: 8HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.40CX Basic pKa: 8.66CX LogP: 0.47CX LogD: -0.81
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.52Np Likeness Score: 0.53

References

1. Lin H, Luengo JI..  (2019)  Nucleoside protein arginine methyltransferase 5 (PRMT5) inhibitors.,  29  (11): [PMID:30956011] [10.1016/j.bmcl.2019.03.042]

Source