The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(4-((5-(hydroxymethyl)-3-(4-phenoxyphenyl)-1H-pyrazol-1-yl)methyl)phenyl)but-2-enamide ID: ALA4517485
PubChem CID: 155541029
Max Phase: Preclinical
Molecular Formula: C27H25N3O3
Molecular Weight: 439.52
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C/C=C/C(=O)Nc1ccc(Cn2nc(-c3ccc(Oc4ccccc4)cc3)cc2CO)cc1
Standard InChI: InChI=1S/C27H25N3O3/c1-2-6-27(32)28-22-13-9-20(10-14-22)18-30-23(19-31)17-26(29-30)21-11-15-25(16-12-21)33-24-7-4-3-5-8-24/h2-17,31H,18-19H2,1H3,(H,28,32)/b6-2+
Standard InChI Key: ZABVMZNQBAUCFZ-QHHAFSJGSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
34.3413 -5.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0082 -6.0088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.6646 -5.5219 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.4022 -4.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5859 -4.7582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0142 -6.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7262 -7.2252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8733 -4.0786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6880 -4.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1591 -3.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8166 -2.7446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9983 -2.6726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5309 -3.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2869 -2.0763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.1008 -2.1495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4405 -2.8948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2536 -2.9682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7248 -2.2995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3771 -1.5553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5650 -1.4855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5669 -5.7976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9536 -5.2574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.7335 -8.0396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4446 -8.4379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1467 -8.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1330 -7.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4213 -6.8058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8603 -8.4186 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.8724 -9.2357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5861 -9.6338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1708 -9.6547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.5981 -10.4509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3118 -10.8490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
6 7 1 0
6 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
4 8 1 0
11 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
1 21 1 0
21 22 1 0
7 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 7 1 0
25 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
30 32 2 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.52Molecular Weight (Monoisotopic): 439.1896AlogP: 5.40#Rotatable Bonds: 8Polar Surface Area: 76.38Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.86CX LogP: 5.19CX LogD: 5.19Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: -1.02
References 1. Ran F, Liu Y, Zhang D, Liu M, Zhao G.. (2019) Discovery of novel pyrazole derivatives as potential anticancer agents in MCL., 29 (9): [PMID:30857748 ] [10.1016/j.bmcl.2019.03.005 ]