The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-((4-((2-(Dimethylphosphoryl)phenyl)amino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl)amino)phenyl)(morpholino)methanone ID: ALA4517847
PubChem CID: 155541058
Max Phase: Preclinical
Molecular Formula: C25H27N6O3P
Molecular Weight: 490.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CP(C)(=O)c1ccccc1Nc1nc(Nc2ccc(C(=O)N3CCOCC3)cc2)nc2[nH]ccc12
Standard InChI: InChI=1S/C25H27N6O3P/c1-35(2,33)21-6-4-3-5-20(21)28-23-19-11-12-26-22(19)29-25(30-23)27-18-9-7-17(8-10-18)24(32)31-13-15-34-16-14-31/h3-12H,13-16H2,1-2H3,(H3,26,27,28,29,30)
Standard InChI Key: RNTHIFILWIXOMD-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
5.9754 -16.4387 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9742 -17.2624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6864 -17.6714 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4002 -17.2619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3945 -16.4382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6846 -16.0258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8549 -15.2242 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6700 -15.1396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0051 -15.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1134 -17.6682 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1181 -18.4854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4125 -18.8940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4168 -19.7105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1274 -20.1158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8351 -19.6987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8272 -18.8836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5305 -18.4674 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
10.2426 -18.8684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5217 -17.6503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5246 -19.2832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2621 -17.6704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2614 -18.4918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5491 -18.9024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5481 -19.7229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2602 -20.1329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9747 -19.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9722 -18.9013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2606 -20.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5532 -21.3591 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8488 -20.9496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1434 -21.3551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1396 -22.1726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8474 -22.5830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5590 -22.1759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9686 -21.3583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
6 5 2 0
6 1 1 0
7 6 1 0
8 7 1 0
9 8 2 0
5 9 1 0
4 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
16 17 1 0
17 18 1 0
17 19 2 0
17 20 1 0
2 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
29 34 1 0
28 35 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.50Molecular Weight (Monoisotopic): 490.1882AlogP: 4.17#Rotatable Bonds: 6Polar Surface Area: 112.24Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.74CX Basic pKa: 6.03CX LogP: 2.68CX LogD: 2.68Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.35Np Likeness Score: -1.39
References 1. Wang R, Chen Y, Zhao X, Yu S, Yang B, Wu T, Guo J, Hao C, Zhao D, Cheng M.. (2019) Design, synthesis and biological evaluation of novel 7H-pyrrolo[2,3-d]pyrimidine derivatives as potential FAK inhibitors and anticancer agents., 183 [PMID:31550660 ] [10.1016/j.ejmech.2019.111716 ]