(4-((4-((2-(Dimethylphosphoryl)phenyl)amino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl)amino)phenyl)(morpholino)methanone

ID: ALA4517847

PubChem CID: 155541058

Max Phase: Preclinical

Molecular Formula: C25H27N6O3P

Molecular Weight: 490.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CP(C)(=O)c1ccccc1Nc1nc(Nc2ccc(C(=O)N3CCOCC3)cc2)nc2[nH]ccc12

Standard InChI:  InChI=1S/C25H27N6O3P/c1-35(2,33)21-6-4-3-5-20(21)28-23-19-11-12-26-22(19)29-25(30-23)27-18-9-7-17(8-10-18)24(32)31-13-15-34-16-14-31/h3-12H,13-16H2,1-2H3,(H3,26,27,28,29,30)

Standard InChI Key:  RNTHIFILWIXOMD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    5.9754  -16.4387    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9742  -17.2624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6864  -17.6714    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4002  -17.2619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3945  -16.4382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6846  -16.0258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8549  -15.2242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6700  -15.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0051  -15.8890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1134  -17.6682    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1181  -18.4854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4125  -18.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4168  -19.7105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1274  -20.1158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8351  -19.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8272  -18.8836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5305  -18.4674    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   10.2426  -18.8684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5217  -17.6503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5246  -19.2832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2621  -17.6704    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2614  -18.4918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5491  -18.9024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5481  -19.7229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2602  -20.1329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9747  -19.7205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9722  -18.9013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2606  -20.9501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5532  -21.3591    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8488  -20.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1434  -21.3551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1396  -22.1726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8474  -22.5830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5590  -22.1759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9686  -21.3583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  6  5  2  0
  6  1  1  0
  7  6  1  0
  8  7  1  0
  9  8  2  0
  5  9  1  0
  4 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 17 20  1  0
  2 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 25 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 29 34  1  0
 28 35  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4517847

    ---

Associated Targets(Human)

PTK2 Tclin Focal adhesion kinase 1 (4730 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MDA-MB-231 (73002 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HK-2 (249 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 490.50Molecular Weight (Monoisotopic): 490.1882AlogP: 4.17#Rotatable Bonds: 6
Polar Surface Area: 112.24Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.74CX Basic pKa: 6.03CX LogP: 2.68CX LogD: 2.68
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.35Np Likeness Score: -1.39

References

1. Wang R, Chen Y, Zhao X, Yu S, Yang B, Wu T, Guo J, Hao C, Zhao D, Cheng M..  (2019)  Design, synthesis and biological evaluation of novel 7H-pyrrolo[2,3-d]pyrimidine derivatives as potential FAK inhibitors and anticancer agents.,  183  [PMID:31550660] [10.1016/j.ejmech.2019.111716]

Source