(R)-2-(1-(3-chlorophenyl)-2-hydroxyethyl)-6-(2-((1-methyl-1H-pyrazol-4-yl)amino)pyrimidin-4-yl)isoindolin-1-one

ID: ALA4517851

PubChem CID: 146634283

Max Phase: Preclinical

Molecular Formula: C24H21ClN6O2

Molecular Weight: 460.93

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1cc(Nc2nccc(-c3ccc4c(c3)C(=O)N([C@@H](CO)c3cccc(Cl)c3)C4)n2)cn1

Standard InChI:  InChI=1S/C24H21ClN6O2/c1-30-13-19(11-27-30)28-24-26-8-7-21(29-24)15-5-6-17-12-31(23(33)20(17)10-15)22(14-32)16-3-2-4-18(25)9-16/h2-11,13,22,32H,12,14H2,1H3,(H,26,28,29)/t22-/m0/s1

Standard InChI Key:  BPOZAQHOAURPCX-QFIPXVFZSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   29.2317   -7.0534    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2306   -7.8729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9386   -8.2819    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.6483   -7.8725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6455   -7.0498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9369   -6.6445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3531   -8.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3531   -9.0975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0606   -9.5049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0566   -7.8700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5226   -8.2810    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.7647   -8.2737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7717   -9.0922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5523   -9.3385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0279   -8.6722    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5410   -8.0142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7869   -7.2349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.8450   -8.6652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2597   -9.3694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2475   -7.9540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0649   -7.9507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4674   -7.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0527   -6.5352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2313   -6.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8326   -7.2558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0768   -9.3624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5219   -9.0982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2845   -7.2338    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   27.8614   -9.5740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1133  -10.3514    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.9305  -10.3521    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.1836   -9.5751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4104  -11.0135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 13  2  0
 12 10  2  0
 10  7  1  0
  4  7  1  0
  2 11  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 12  1  0
 16 17  2  0
 15 18  1  0
 18 19  1  6
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 19 26  1  0
 11 27  1  0
 22 28  1  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  1  0
 32 27  2  0
 31 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4517851

    ---

Associated Targets(Human)

MAPK1 Tchem MAP kinase ERK2 (25055 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.93Molecular Weight (Monoisotopic): 460.1415AlogP: 3.96#Rotatable Bonds: 6
Polar Surface Area: 96.17Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.69CX Basic pKa: 1.91CX LogP: 3.38CX LogD: 3.38
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.45Np Likeness Score: -1.44

References

1. Ji D, Zhang L, Zhu Q, Bai Y, Wu Y, Xu Y..  (2019)  Discovery of potent, orally bioavailable ERK1/2 inhibitors with isoindolin-1-one structure by structure-based drug design.,  164  [PMID:30605831] [10.1016/j.ejmech.2018.12.040]

Source