4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[6-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrimidin-4-yl]amino]phenyl]cyclohexanecarboxamide

ID: ALA4517979

PubChem CID: 134451952

Max Phase: Preclinical

Molecular Formula: C30H34N8O2

Molecular Weight: 538.66

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)C/C=C/C(=O)NC1CCC(C(=O)Nc2cccc(Nc3cc(-c4cnc5[nH]ccc5c4)ncn3)c2)CC1

Standard InChI:  InChI=1S/C30H34N8O2/c1-38(2)14-4-7-28(39)36-23-10-8-20(9-11-23)30(40)37-25-6-3-5-24(16-25)35-27-17-26(33-19-34-27)22-15-21-12-13-31-29(21)32-18-22/h3-7,12-13,15-20,23H,8-11,14H2,1-2H3,(H,31,32)(H,36,39)(H,37,40)(H,33,34,35)/b7-4+

Standard InChI Key:  TWNLBUPLPGVPQC-QPJJXVBHSA-N

Molfile:  

 
     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   18.2113   -4.8161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4323   -5.0705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4323   -5.8862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2112   -6.1406    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.6929   -5.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7262   -6.2970    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0154   -5.8914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0154   -5.0711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7237   -4.6595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3073   -4.6593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5991   -5.0725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8908   -4.6623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8908   -3.8428    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5967   -3.4378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3073   -3.8456    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1786   -5.0700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4705   -4.6623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7665   -5.0755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0499   -4.6653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0499   -3.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7599   -3.4367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4705   -3.8486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3418   -5.0730    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6338   -4.6653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9257   -5.0730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9257   -5.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2135   -6.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5055   -5.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5055   -5.0729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2135   -4.6653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7974   -6.3042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0893   -5.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3813   -6.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6691   -5.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9610   -6.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2529   -5.8924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5448   -6.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2529   -5.0729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0893   -5.0729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6338   -3.8458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  3  4  1  0
  5  4  1  0
  1  5  2  0
  6  3  1  0
  7  6  2  0
  8  7  1  0
  9  8  2  0
  2  9  1  0
  8 10  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 10 15  1  0
 16 12  1  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 17 22  1  0
 19 23  1  0
 23 24  1  0
 24 25  1  0
 26 25  1  0
 27 26  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 25 30  1  0
 28 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 36 38  1  0
 32 39  2  0
 24 40  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4517979

    ---

Associated Targets(Human)

PIP4K2A Tbio Phosphatidylinositol-5-phosphate 4-kinase type-2 alpha (1501 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PIP4K2B Tchem Phosphatidylinositol-5-phosphate 4-kinase type-2 beta (392 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 538.66Molecular Weight (Monoisotopic): 538.2805AlogP: 4.49#Rotatable Bonds: 9
Polar Surface Area: 127.93Molecular Species: BASEHBA: 7HBD: 4
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.88CX Basic pKa: 8.81CX LogP: 3.61CX LogD: 2.19
Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.23Np Likeness Score: -1.23

References

1. Manz TD, Sivakumaren SC, Yasgar A, Hall MD, Davis MI, Seo HS, Card JD, Ficarro SB, Shim H, Marto JA, Dhe-Paganon S, Sasaki AT, Boxer MB, Simeonov A, Cantley LC, Shen M, Zhang T, Ferguson FM, Gray NS..  (2020)  Structure-Activity Relationship Study of Covalent Pan-phosphatidylinositol 5-Phosphate 4-Kinase Inhibitors.,  11  (3): [PMID:32184968] [10.1021/acsmedchemlett.9b00402]

Source