The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,1'-((2S,5S)-3,6-Dioxopiperazine-2,5-diyl)bis(methylene)bis(1H-indole-2-carbaldehyde) ID: ALA4518212
PubChem CID: 155541320
Max Phase: Preclinical
Molecular Formula: C24H20N4O4
Molecular Weight: 428.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=Cc1cc2ccccc2n1C[C@@H]1NC(=O)[C@H](Cn2c(C=O)cc3ccccc32)NC1=O
Standard InChI: InChI=1S/C24H20N4O4/c29-13-17-9-15-5-1-3-7-21(15)27(17)11-19-23(31)26-20(24(32)25-19)12-28-18(14-30)10-16-6-2-4-8-22(16)28/h1-10,13-14,19-20H,11-12H2,(H,25,32)(H,26,31)/t19-,20-/m0/s1
Standard InChI Key: QKVUBOQBQKPALP-PMACEKPBSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
4.5936 -3.3224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5936 -4.1396 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2989 -4.5441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0042 -4.1396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0042 -3.3224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2989 -2.9097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2989 -2.0925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2989 -5.3613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7113 -4.5492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8847 -2.9159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4196 -4.1417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1782 -3.3266 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2948 -4.3161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0936 -4.1438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3036 -3.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5041 -3.3257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8841 -3.6096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4283 -3.0026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1745 -2.2299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3768 -2.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8334 -2.6748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0901 -3.4452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7112 -3.8652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1642 -4.4673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4126 -5.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2075 -5.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7536 -4.8047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5024 -4.0344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7021 -4.6892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5340 -5.4889 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8968 -2.7790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0666 -1.9796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
3 8 2 0
4 9 1 1
1 10 1 1
9 11 1 0
10 12 1 0
12 18 1 0
17 13 1 0
13 14 2 0
14 12 1 0
11 24 1 0
23 15 1 0
15 16 2 0
16 11 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
14 29 1 0
29 30 2 0
16 31 1 0
31 32 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.45Molecular Weight (Monoisotopic): 428.1485AlogP: 1.90#Rotatable Bonds: 6Polar Surface Area: 102.20Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.62CX Basic pKa: ┄CX LogP: 1.73CX LogD: 1.73Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.46Np Likeness Score: -0.05
References 1. Simon G, Bérubé C, Voyer N, Grenier D.. (2019) Anti-biofilm and anti-adherence properties of novel cyclic dipeptides against oral pathogens., 27 (12): [PMID:30528685 ] [10.1016/j.bmc.2018.11.042 ]