1,1'-((2S,5S)-3,6-Dioxopiperazine-2,5-diyl)bis(methylene)bis(1H-indole-2-carbaldehyde)

ID: ALA4518212

PubChem CID: 155541320

Max Phase: Preclinical

Molecular Formula: C24H20N4O4

Molecular Weight: 428.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=Cc1cc2ccccc2n1C[C@@H]1NC(=O)[C@H](Cn2c(C=O)cc3ccccc32)NC1=O

Standard InChI:  InChI=1S/C24H20N4O4/c29-13-17-9-15-5-1-3-7-21(15)27(17)11-19-23(31)26-20(24(32)25-19)12-28-18(14-30)10-16-6-2-4-8-22(16)28/h1-10,13-14,19-20H,11-12H2,(H,25,32)(H,26,31)/t19-,20-/m0/s1

Standard InChI Key:  QKVUBOQBQKPALP-PMACEKPBSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    4.5936   -3.3224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5936   -4.1396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2989   -4.5441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0042   -4.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0042   -3.3224    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2989   -2.9097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2989   -2.0925    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2989   -5.3613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7113   -4.5492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8847   -2.9159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4196   -4.1417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1782   -3.3266    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2948   -4.3161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0936   -4.1438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3036   -3.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5041   -3.3257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8841   -3.6096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4283   -3.0026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1745   -2.2299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3768   -2.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8334   -2.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0901   -3.4452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7112   -3.8652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1642   -4.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4126   -5.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2075   -5.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7536   -4.8047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5024   -4.0344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7021   -4.6892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5340   -5.4889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8968   -2.7790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0666   -1.9796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  3  8  2  0
  4  9  1  1
  1 10  1  1
  9 11  1  0
 10 12  1  0
 12 18  1  0
 17 13  1  0
 13 14  2  0
 14 12  1  0
 11 24  1  0
 23 15  1  0
 15 16  2  0
 16 11  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 14 29  1  0
 29 30  2  0
 16 31  1  0
 31 32  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4518212

    ---

Associated Targets(non-human)

Fusobacterium nucleatum (386 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Porphyromonas gingivalis (651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Streptococcus mutans (2687 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 428.45Molecular Weight (Monoisotopic): 428.1485AlogP: 1.90#Rotatable Bonds: 6
Polar Surface Area: 102.20Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.62CX Basic pKa: CX LogP: 1.73CX LogD: 1.73
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.46Np Likeness Score: -0.05

References

1. Simon G, Bérubé C, Voyer N, Grenier D..  (2019)  Anti-biofilm and anti-adherence properties of novel cyclic dipeptides against oral pathogens.,  27  (12): [PMID:30528685] [10.1016/j.bmc.2018.11.042]

Source