(S)-methyl 2-(benzyloxycarbonylamino)-5-oxododecanoate

ID: ALA4518289

PubChem CID: 71100496

Max Phase: Preclinical

Molecular Formula: C21H31NO5

Molecular Weight: 377.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCC(=O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)OC

Standard InChI:  InChI=1S/C21H31NO5/c1-3-4-5-6-10-13-18(23)14-15-19(20(24)26-2)22-21(25)27-16-17-11-8-7-9-12-17/h7-9,11-12,19H,3-6,10,13-16H2,1-2H3,(H,22,25)/t19-/m0/s1

Standard InChI Key:  DFMNYJXJCKYQOY-IBGZPJMESA-N

Molfile:  

 
     RDKit          2D

 27 27  0  0  0  0  0  0  0  0999 V2000
   26.8661  -16.4388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5779  -16.8515    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.8661  -15.6174    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.2898  -16.4388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0016  -16.8515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7134  -16.4388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0016  -17.6728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.4253  -16.8515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2898  -15.6174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0016  -15.2088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0016  -14.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7134  -13.9748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7134  -13.1535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4253  -12.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4253  -11.9153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1371  -11.5108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8448  -11.9153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5566  -11.5108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2935  -13.9796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1580  -16.8467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1573  -17.6639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4492  -18.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7451  -17.6605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0375  -18.0678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0363  -18.8858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7486  -19.2949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4533  -18.8853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  2  0
  6  8  1  0
  4  9  1  1
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 11 19  2  0
  1 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
M  END

Associated Targets(non-human)

Mboat4 Ghrelin O-acyltransferase (37 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 377.48Molecular Weight (Monoisotopic): 377.2202AlogP: 4.16#Rotatable Bonds: 13
Polar Surface Area: 81.70Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.40CX Basic pKa: CX LogP: 4.63CX LogD: 4.63
Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.41Np Likeness Score: 0.14

References

1.  (2012)  Small molecule inhibitors of ghrelin O-acyltransferase, 

Source