The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-((5-chloro-4-((2-(isopropylsulfonyl)phenyl)amino)pyrimidin-2-yl)amino)-3-methoxyphenyl)-3-(2-oxo-2-(piperidin-1-yl)ethyl)imidazolidin-2-one ID: ALA4518307
PubChem CID: 155541352
Max Phase: Preclinical
Molecular Formula: C30H36ClN7O5S
Molecular Weight: 642.18
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N2CCN(CC(=O)N3CCCCC3)C2=O)ccc1Nc1ncc(Cl)c(Nc2ccccc2S(=O)(=O)C(C)C)n1
Standard InChI: InChI=1S/C30H36ClN7O5S/c1-20(2)44(41,42)26-10-6-5-9-24(26)33-28-22(31)18-32-29(35-28)34-23-12-11-21(17-25(23)43-3)38-16-15-37(30(38)40)19-27(39)36-13-7-4-8-14-36/h5-6,9-12,17-18,20H,4,7-8,13-16,19H2,1-3H3,(H2,32,33,34,35)
Standard InChI Key: WMYGNTKPSDMTJG-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 48 0 0 0 0 0 0 0 0999 V2000
28.4036 -28.9195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5864 -28.9195 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.9950 -29.6272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8833 -26.8765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8822 -27.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5902 -28.1050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2999 -27.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2971 -26.8729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5885 -26.4676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0083 -28.1030 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.7153 -27.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8822 -29.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8820 -30.1478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1746 -28.9218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4203 -28.1012 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.1269 -27.6922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1261 -26.8741 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.4128 -26.4668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7091 -26.8782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9987 -26.4742 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
31.8351 -28.1000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5423 -27.6907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2495 -28.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9563 -27.6915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9559 -26.8734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2427 -26.4657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5389 -26.8768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2493 -28.9173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.9569 -29.3261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6606 -25.6459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6663 -26.4607 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.4430 -26.7071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9174 -26.0446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4338 -25.3888 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9962 -25.1702 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6809 -24.6098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4790 -24.4344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7261 -23.6554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.0300 -25.0378 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.7809 -25.8147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3281 -26.4169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1275 -26.2455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3767 -25.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8266 -24.8584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
6 2 1 0
7 10 1 0
10 11 1 0
2 12 1 0
12 13 1 0
12 14 1 0
11 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 11 1 0
19 20 1 0
16 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
23 28 1 0
28 29 1 0
25 31 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 30 1 0
30 35 2 0
34 36 1 0
36 37 1 0
37 38 2 0
37 39 1 0
39 40 1 0
39 44 1 0
40 41 1 0
41 42 1 0
42 43 1 0
43 44 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 642.18Molecular Weight (Monoisotopic): 641.2187AlogP: 5.06#Rotatable Bonds: 10Polar Surface Area: 137.07Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.55CX Basic pKa: 3.15CX LogP: 3.58CX LogD: 3.58Aromatic Rings: 3Heavy Atoms: 44QED Weighted: 0.31Np Likeness Score: -1.84
References 1. Lei H, Jiang N, Miao X, Xing L, Guo M, Liu Y, Xu H, Gong P, Zuo D, Zhai X.. (2019) Discovery of novel mutant-combating ALK and ROS1 dual inhibitors bearing imidazolidin-2-one moiety with reasonable PK properties., 171 [PMID:30927566 ] [10.1016/j.ejmech.2019.03.038 ]