The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(4-methylbenzyl)-1-(2-(3,4,5-trimethoxyphenylamino)pyridin-4-yl)piperidine-3-carboxamide ID: ALA4518526
PubChem CID: 155541437
Max Phase: Preclinical
Molecular Formula: C28H34N4O4
Molecular Weight: 490.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(Nc2cc(N3CCC[C@H](C(=O)NCc4ccc(C)cc4)C3)ccn2)cc(OC)c1OC
Standard InChI: InChI=1S/C28H34N4O4/c1-19-7-9-20(10-8-19)17-30-28(33)21-6-5-13-32(18-21)23-11-12-29-26(16-23)31-22-14-24(34-2)27(36-4)25(15-22)35-3/h7-12,14-16,21H,5-6,13,17-18H2,1-4H3,(H,29,31)(H,30,33)/t21-/m0/s1
Standard InChI Key: PPPBABYZSRYBJZ-NRFANRHFSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
6.0835 -3.3307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0835 -4.1520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7929 -4.5606 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5023 -4.1520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5023 -3.3307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7929 -2.9180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7925 -5.3811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0790 -5.7891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0787 -6.6096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7911 -7.0232 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5052 -6.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5021 -5.7868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2154 -2.9242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9260 -3.3348 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2178 -2.1028 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6390 -2.9283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3497 -3.3390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3459 -4.1613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0516 -4.5760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7656 -4.1653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7654 -3.3398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0550 -2.9329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3667 -7.0220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6584 -6.6144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6588 -5.7986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9514 -5.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2432 -5.8007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2470 -6.6221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9550 -7.0260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5413 -7.0342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8316 -6.6290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5344 -5.3940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5323 -4.5768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9507 -4.5739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6580 -4.1647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4731 -4.5744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
5 13 1 6
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
9 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
28 30 1 0
30 31 1 0
27 32 1 0
32 33 1 0
26 34 1 0
34 35 1 0
20 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.60Molecular Weight (Monoisotopic): 490.2580AlogP: 4.69#Rotatable Bonds: 9Polar Surface Area: 84.95Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.35CX LogP: 4.31CX LogD: 2.94Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.45Np Likeness Score: -1.23
References 1. Liu S, Jiang Y, Yan R, Li Z, Wan S, Zhang T, Wu X, Hou J, Zhu Z, Tian Y, Zhang J.. (2019) Design, synthesis and biological evaluations of 2-amino-4-(1-piperidine) pyridine derivatives as novel anti crizotinib-resistant ALK/ROS1 dual inhibitors., 179 [PMID:31260890 ] [10.1016/j.ejmech.2019.06.043 ]