The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Endolide B ID: ALA4518571
PubChem CID: 132559161
Max Phase: Preclinical
Molecular Formula: C28H34N4O7
Molecular Weight: 538.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)[C@@H]1NC(=O)[C@H](Cc2ccoc2)N(C)C(=O)[C@H](Cc2ccoc2)NC(=O)[C@H](Cc2ccoc2)N(C)C1=O
Standard InChI: InChI=1S/C28H34N4O7/c1-17(2)24-28(36)32(4)22(12-19-6-9-38-15-19)25(33)29-21(11-18-5-8-37-14-18)27(35)31(3)23(26(34)30-24)13-20-7-10-39-16-20/h5-10,14-17,21-24H,11-13H2,1-4H3,(H,29,33)(H,30,34)/t21-,22-,23-,24-/m0/s1
Standard InChI Key: VEZDPJCGIWZHLV-ZJZGAYNASA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
19.6243 -18.3347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4491 -18.3347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7664 -17.5730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1651 -18.7492 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5713 -19.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5671 -20.2858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2830 -19.0423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9991 -19.4528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2787 -20.6998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7484 -18.1685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9084 -18.7450 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2098 -17.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6179 -16.9038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4398 -16.8138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6055 -16.0066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8905 -15.5983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2804 -16.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0905 -20.2724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8981 -20.4403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.3087 -19.7242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7547 -19.1113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9808 -20.8678 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4938 -19.4568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6690 -19.4522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4896 -20.2817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5622 -21.5796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9727 -22.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7374 -21.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3231 -22.2906 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0214 -21.1609 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4449 -21.7485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7737 -20.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0622 -20.2733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7975 -22.3045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5541 -23.0113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9803 -19.4531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1746 -19.2761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7559 -19.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3030 -20.6067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
5 6 1 0
5 7 1 1
7 8 1 0
6 9 2 0
4 10 1 0
1 11 1 0
1 12 1 1
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 2 0
17 13 1 0
8 18 2 0
18 19 1 0
19 20 1 0
20 21 2 0
21 8 1 0
6 22 1 0
11 23 1 0
23 24 2 0
23 25 1 0
22 26 1 0
26 27 1 1
26 28 1 0
28 29 2 0
28 30 1 0
30 25 1 0
30 31 1 0
25 32 1 1
32 33 1 0
27 34 1 0
27 35 1 0
33 36 2 0
36 37 1 0
37 38 1 0
38 39 2 0
39 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.60Molecular Weight (Monoisotopic): 538.2427AlogP: 1.79#Rotatable Bonds: 7Polar Surface Area: 138.24Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.19CX Basic pKa: ┄CX LogP: 1.58CX LogD: 1.58Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.47Np Likeness Score: 1.04
References 1. Davison EK, Cameron AJ, Harris PWR, Brimble MA.. (2019) Synthesis of endolides A and B: naturally occurring N -methylated cyclic tetrapeptides., 10 (5): [PMID:31191859 ] [10.1039/C9MD00050J ]