Endolide B

ID: ALA4518571

PubChem CID: 132559161

Max Phase: Preclinical

Molecular Formula: C28H34N4O7

Molecular Weight: 538.60

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)[C@@H]1NC(=O)[C@H](Cc2ccoc2)N(C)C(=O)[C@H](Cc2ccoc2)NC(=O)[C@H](Cc2ccoc2)N(C)C1=O

Standard InChI:  InChI=1S/C28H34N4O7/c1-17(2)24-28(36)32(4)22(12-19-6-9-38-15-19)25(33)29-21(11-18-5-8-37-14-18)27(35)31(3)23(26(34)30-24)13-20-7-10-39-16-20/h5-10,14-17,21-24H,11-13H2,1-4H3,(H,29,33)(H,30,34)/t21-,22-,23-,24-/m0/s1

Standard InChI Key:  VEZDPJCGIWZHLV-ZJZGAYNASA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   19.6243  -18.3347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4491  -18.3347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7664  -17.5730    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.1651  -18.7492    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.5713  -19.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5671  -20.2858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2830  -19.0423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9991  -19.4528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2787  -20.6998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7484  -18.1685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9084  -18.7450    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2098  -17.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6179  -16.9038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4398  -16.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6055  -16.0066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8905  -15.5983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2804  -16.1508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0905  -20.2724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8981  -20.4403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.3087  -19.7242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7547  -19.1113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9808  -20.8678    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.4938  -19.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6690  -19.4522    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4896  -20.2817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5622  -21.5796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9727  -22.2998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7374  -21.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3231  -22.2906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0214  -21.1609    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.4449  -21.7485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7737  -20.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0622  -20.2733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7975  -22.3045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5541  -23.0113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9803  -19.4531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1746  -19.2761    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7559  -19.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3030  -20.6067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  1
  7  8  1  0
  6  9  2  0
  4 10  1  0
  1 11  1  0
  1 12  1  1
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 13  1  0
  8 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21  8  1  0
  6 22  1  0
 11 23  1  0
 23 24  2  0
 23 25  1  0
 22 26  1  0
 26 27  1  1
 26 28  1  0
 28 29  2  0
 28 30  1  0
 30 25  1  0
 30 31  1  0
 25 32  1  1
 32 33  1  0
 27 34  1  0
 27 35  1  0
 33 36  2  0
 36 37  1  0
 37 38  1  0
 38 39  2  0
 39 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4518571

    ---

Associated Targets(Human)

HTR2B Tclin Serotonin 2b (5-HT2b) receptor (10323 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 538.60Molecular Weight (Monoisotopic): 538.2427AlogP: 1.79#Rotatable Bonds: 7
Polar Surface Area: 138.24Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.19CX Basic pKa: CX LogP: 1.58CX LogD: 1.58
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.47Np Likeness Score: 1.04

References

1. Davison EK, Cameron AJ, Harris PWR, Brimble MA..  (2019)  Synthesis of endolides A and B: naturally occurring N-methylated cyclic tetrapeptides.,  10  (5): [PMID:31191859] [10.1039/C9MD00050J]

Source