The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Paleacenin B ID: ALA4518615
PubChem CID: 155541596
Max Phase: Preclinical
Molecular Formula: C36H48O8
Molecular Weight: 608.77
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCC(=O)c1c(O)c(CC2=C(O)[C@](C)(C/C=C(\C)CCC=C(C)C)C(O)=C(C(C)=O)C2=O)c(O)c(CC=C(C)C)c1OC
Standard InChI: InChI=1S/C36H48O8/c1-10-12-27(38)29-31(40)25(30(39)24(33(29)44-9)16-15-21(4)5)19-26-32(41)28(23(7)37)35(43)36(8,34(26)42)18-17-22(6)14-11-13-20(2)3/h13,15,17,39-40,42-43H,10-12,14,16,18-19H2,1-9H3/b22-17+/t36-/m0/s1
Standard InChI Key: FDKOJCRVMVQXER-YYDUIWCQSA-N
Molfile:
RDKit 2D
44 45 0 0 0 0 0 0 0 0999 V2000
9.2023 -13.7354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2012 -14.5384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8968 -14.9432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5941 -14.5379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5913 -13.7318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8950 -13.3348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5110 -13.3352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8926 -12.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5867 -12.1316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1960 -12.1359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2791 -12.5299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9732 -12.1274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2809 -13.3288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9778 -13.7264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8966 -15.7439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9738 -14.9571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7740 -12.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1785 -13.3392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5786 -12.6433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4892 -13.7437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4892 -14.5444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1821 -14.9406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8750 -14.5444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8750 -13.7437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1821 -15.7454 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7986 -14.9457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1027 -14.5464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7998 -15.7505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5669 -13.3446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9733 -12.6483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5708 -11.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7702 -11.9567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9690 -11.2618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3677 -11.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5670 -11.2651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1645 -10.5751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3638 -10.5776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5627 -9.8786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7964 -13.3462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2859 -14.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2872 -15.7420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9832 -16.1412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9845 -16.9419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6737 -15.7398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
6 8 1 0
8 9 1 0
8 10 2 0
9 11 1 0
11 12 1 0
5 13 1 0
13 14 1 0
3 15 1 0
2 16 1 0
18 17 1 1
19 18 1 0
20 21 2 0
20 18 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 18 1 0
22 25 2 0
21 26 1 0
26 27 2 0
26 28 1 0
24 29 1 0
23 16 1 0
17 30 1 0
30 31 2 0
31 32 1 0
31 33 1 0
32 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
36 38 1 0
20 39 1 0
4 40 1 0
40 41 1 0
41 42 2 0
42 43 1 0
42 44 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 608.77Molecular Weight (Monoisotopic): 608.3349AlogP: 8.03#Rotatable Bonds: 14Polar Surface Area: 141.36Molecular Species: ACIDHBA: 8HBD: 4#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.17CX Basic pKa: ┄CX LogP: 7.81CX LogD: 2.32Aromatic Rings: 1Heavy Atoms: 44QED Weighted: 0.09Np Likeness Score: 2.22
References 1. Arvizu-Espinosa MG, von Poser GL, Henriques AT, Mendoza-Ruiz A, Cardador-Martínez A, Gesto-Borroto R, Núñez-Aragón PN, Villarreal-Ortega ML, Sharma A, Cardoso-Taketa A.. (2019) Bioactive Dimeric Acylphloroglucinols from the Mexican Fern Elaphoglossum paleaceum., 82 (4): [PMID:30920216 ] [10.1021/acs.jnatprod.8b00677 ]