The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(1-(3-chlorophenyl)-2-hydroxyethyl)-6-(2-((2-hydroxyethyl)amino)pyrimidin-4-yl)isoindolin-1-one ID: ALA4518783
PubChem CID: 146634740
Max Phase: Preclinical
Molecular Formula: C22H21ClN4O3
Molecular Weight: 424.89
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1c2cc(-c3ccnc(NCCO)n3)ccc2CN1C(CO)c1cccc(Cl)c1
Standard InChI: InChI=1S/C22H21ClN4O3/c23-17-3-1-2-15(10-17)20(13-29)27-12-16-5-4-14(11-18(16)21(27)30)19-6-7-24-22(26-19)25-8-9-28/h1-7,10-11,20,28-29H,8-9,12-13H2,(H,24,25,26)
Standard InChI Key: MXKZOOSGWALMQP-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
27.6840 -1.1308 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6829 -1.9504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3909 -2.3593 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.1006 -1.9499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0978 -1.1272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3891 -0.7220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8054 -2.3566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8054 -3.1749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5129 -3.5823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5089 -1.9474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9749 -2.3584 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.2170 -2.3511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2240 -3.1697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0046 -3.4160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4801 -2.7496 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.9933 -2.0916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2392 -1.3123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.2973 -2.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7120 -3.4468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6998 -2.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5172 -2.0282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9197 -1.3178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5050 -0.6127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6836 -0.6223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2849 -1.3332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5291 -3.4398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.9742 -3.1756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7368 -1.3112 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
26.2662 -3.5836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2655 -4.4008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 13 2 0
12 10 2 0
10 7 1 0
4 7 1 0
2 11 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 12 1 0
16 17 2 0
15 18 1 0
18 19 1 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
19 26 1 0
11 27 1 0
22 28 1 0
27 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.89Molecular Weight (Monoisotopic): 424.1302AlogP: 2.89#Rotatable Bonds: 7Polar Surface Area: 98.58Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.79CX Basic pKa: 3.85CX LogP: 2.29CX LogD: 2.29Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.54Np Likeness Score: -0.97
References 1. Ji D, Zhang L, Zhu Q, Bai Y, Wu Y, Xu Y.. (2019) Discovery of potent, orally bioavailable ERK1/2 inhibitors with isoindolin-1-one structure by structure-based drug design., 164 [PMID:30605831 ] [10.1016/j.ejmech.2018.12.040 ]