The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
cis-2-(1-(2-Aminothieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl)-4-(3,4-difluorophenyl)-4a,5,8,8a-tetrahydrophthalazin-1(2H)-one ID: ALA4518935
PubChem CID: 155541459
Max Phase: Preclinical
Molecular Formula: C25H24F2N6OS
Molecular Weight: 494.57
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(N2CCC(N3N=C(c4ccc(F)c(F)c4)[C@H]4CC=CC[C@H]4C3=O)CC2)c2ccsc2n1
Standard InChI: InChI=1S/C25H24F2N6OS/c26-19-6-5-14(13-20(19)27)21-16-3-1-2-4-17(16)24(34)33(31-21)15-7-10-32(11-8-15)22-18-9-12-35-23(18)30-25(28)29-22/h1-2,5-6,9,12-13,15-17H,3-4,7-8,10-11H2,(H2,28,29,30)/t16-,17+/m0/s1
Standard InChI Key: BIUDBARWGBKKPN-DLBZAZTESA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
22.2237 -21.6101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2226 -22.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9347 -22.8469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9329 -21.2013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6457 -21.6065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6465 -22.4297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3591 -22.8409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0674 -22.4259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.0626 -21.5997 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.3535 -21.1963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3608 -23.6622 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.3487 -20.3801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0558 -19.9642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0518 -19.1436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3373 -18.7380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6294 -19.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6369 -19.9739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7808 -22.8359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7797 -23.6537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4890 -24.0595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2017 -23.6516 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2005 -22.8293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4866 -22.4149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9136 -24.0601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6408 -20.7889 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
23.6408 -23.2446 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
27.9118 -24.8795 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.6229 -25.2879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3336 -24.8756 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.6172 -23.6459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3287 -24.0491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9321 -23.4969 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
29.5934 -22.7524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7808 -22.8446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6246 -26.1051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7571 -18.7308 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.3309 -17.9208 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 1 0
5 4 1 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 5 1 0
7 11 2 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
10 12 1 0
8 18 1 0
18 19 1 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
21 24 1 0
5 25 1 1
6 26 1 1
24 27 2 0
27 28 1 0
28 29 2 0
29 31 1 0
30 24 1 0
30 31 2 0
31 32 1 0
32 33 1 0
33 34 2 0
34 30 1 0
28 35 1 0
14 36 1 0
15 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.57Molecular Weight (Monoisotopic): 494.1700AlogP: 4.35#Rotatable Bonds: 3Polar Surface Area: 87.71Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.98CX LogP: 4.34CX LogD: 4.33Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.55Np Likeness Score: -1.47
References 1. Salado IG, Singh AK, Moreno-Cinos C, Sakaine G, Siderius M, Van der Veken P, Matheeussen A, van der Meer T, Sadek P, Gul S, Maes L, Sterk GJ, Leurs R, Brown D, Augustyns K.. (2020) Lead Optimization of Phthalazinone Phosphodiesterase Inhibitors as Novel Antitrypanosomal Compounds., 63 (7): [PMID:32196340 ] [10.1021/acs.jmedchem.9b00985 ]