The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((S)-1-(3-(((1S,2R)-2-((3-aminopropylamino)methyl)cyclopropyl)methylamino)propylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl)butyramide ID: ALA4518954
PubChem CID: 155541561
Max Phase: Preclinical
Molecular Formula: C24H41N5O3
Molecular Weight: 447.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCCCNC[C@H]1C[C@H]1CNCCCN
Standard InChI: InChI=1S/C24H41N5O3/c1-2-5-23(31)29-22(14-18-6-8-21(30)9-7-18)24(32)28-13-4-12-27-17-20-15-19(20)16-26-11-3-10-25/h6-9,19-20,22,26-27,30H,2-5,10-17,25H2,1H3,(H,28,32)(H,29,31)/t19-,20+,22-/m0/s1
Standard InChI Key: AZKMTKVSVYHHAA-VWPQPMDRSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
15.0985 -24.9408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3028 -25.3577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0146 -24.9450 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5909 -24.9450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8791 -25.3577 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8791 -26.1790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1673 -26.5876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5909 -26.5876 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4596 -26.1790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7477 -26.5876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5909 -24.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8791 -23.7151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8821 -22.8927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1711 -22.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4624 -22.8928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4650 -23.7183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1725 -24.1232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7500 -22.4810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7264 -25.3577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4383 -24.9450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1460 -25.3577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8578 -24.9450 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5697 -25.3577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3028 -26.1790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2815 -24.9450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6928 -24.2286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8073 -25.3494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5181 -24.9349 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2310 -25.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9417 -24.9313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6505 -25.3422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3613 -24.9277 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
6 8 2 0
7 9 1 0
9 10 1 0
4 11 1 1
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
15 18 1 0
3 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
2 24 2 0
25 23 1 1
1 25 1 0
26 1 1 0
25 26 1 0
1 27 1 1
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.62Molecular Weight (Monoisotopic): 447.3209AlogP: 0.89#Rotatable Bonds: 17Polar Surface Area: 128.51Molecular Species: BASEHBA: 6HBD: 6#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 7#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.42CX Basic pKa: 10.80CX LogP: -1.19CX LogD: -6.20Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.20Np Likeness Score: 0.28
References 1. Kachel HS, Franzyk H, Mellor IR.. (2019) Philanthotoxin Analogues That Selectively Inhibit Ganglionic Nicotinic Acetylcholine Receptors with Exceptional Potency., 62 (13): [PMID:31244109 ] [10.1021/acs.jmedchem.9b00519 ]