(S)-acetoxymethyl 5-morpholino-2-(3-(naphthalen-2-yl)acrylamido)-5-oxopentanoate

ID: ALA4518987

PubChem CID: 132496931

Max Phase: Preclinical

Molecular Formula: C25H28N2O7

Molecular Weight: 468.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)OCOC(=O)[C@H](CCC(=O)N1CCOCC1)NC(=O)/C=C/c1ccc2ccccc2c1

Standard InChI:  InChI=1S/C25H28N2O7/c1-18(28)33-17-34-25(31)22(9-11-24(30)27-12-14-32-15-13-27)26-23(29)10-7-19-6-8-20-4-2-3-5-21(20)16-19/h2-8,10,16,22H,9,11-15,17H2,1H3,(H,26,29)/b10-7+/t22-/m0/s1

Standard InChI Key:  BPYOREDREOFAKZ-FNNXTJRKSA-N

Molfile:  

 
     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
   39.6214  -10.6235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3291  -10.2149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6214  -11.4407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9137  -11.8493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.3291  -11.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3291  -12.6665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.0368  -11.4407    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.2060  -11.4407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4983  -11.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2060  -10.6235    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.3291   -9.3977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0368   -8.9891    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.6214   -8.9891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.7383   -9.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4439   -8.9962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4481   -8.1787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.7406   -7.7679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0288   -8.1746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7906  -11.4407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0829  -11.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3769  -11.4355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3819  -13.0699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0862  -12.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6692  -12.6615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6732  -11.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9679  -11.4329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2582  -11.8391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2582  -12.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9641  -13.0671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7445  -11.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4522  -11.4407    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.1599  -11.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8800  -11.4407    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.1599  -12.6665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  1  1  1
  3  4  1  0
  3  5  1  0
  5  6  2  0
  5  7  1  0
  4  8  1  0
  8  9  1  0
  8 10  2  0
  2 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  1  0
 12 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
  9 19  2  0
 19 20  1  0
 20 21  2  0
 21 25  1  0
 24 22  1  0
 22 23  2  0
 23 20  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 24  2  0
  7 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 32 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4518987

    ---

Associated Targets(Human)

PIN1 Tchem Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 (36611 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PC-3 (62116 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.51Molecular Weight (Monoisotopic): 468.1897AlogP: 2.04#Rotatable Bonds: 9
Polar Surface Area: 111.24Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.84CX Basic pKa: CX LogP: 1.66CX LogD: 1.66
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.34Np Likeness Score: -0.26

References

1. Ieda N, Itoh K, Inoue Y, Izumiya Y, Kawaguchi M, Miyata N, Nakagawa H..  (2019)  An irreversible inhibitor of peptidyl-prolyl cis/trans isomerase Pin1 and evaluation of cytotoxicity.,  29  (3): [PMID:30585173] [10.1016/j.bmcl.2018.12.044]

Source