The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-acetoxymethyl 5-morpholino-2-(3-(naphthalen-2-yl)acrylamido)-5-oxopentanoate ID: ALA4518987
PubChem CID: 132496931
Max Phase: Preclinical
Molecular Formula: C25H28N2O7
Molecular Weight: 468.51
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)OCOC(=O)[C@H](CCC(=O)N1CCOCC1)NC(=O)/C=C/c1ccc2ccccc2c1
Standard InChI: InChI=1S/C25H28N2O7/c1-18(28)33-17-34-25(31)22(9-11-24(30)27-12-14-32-15-13-27)26-23(29)10-7-19-6-8-20-4-2-3-5-21(20)16-19/h2-8,10,16,22H,9,11-15,17H2,1H3,(H,26,29)/b10-7+/t22-/m0/s1
Standard InChI Key: BPYOREDREOFAKZ-FNNXTJRKSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
39.6214 -10.6235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3291 -10.2149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6214 -11.4407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9137 -11.8493 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.3291 -11.8493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3291 -12.6665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.0368 -11.4407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.2060 -11.4407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4983 -11.8493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2060 -10.6235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.3291 -9.3977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0368 -8.9891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.6214 -8.9891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.7383 -9.4013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4439 -8.9962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4481 -8.1787 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.7406 -7.7679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0288 -8.1746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7906 -11.4407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0829 -11.8493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3769 -11.4355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3819 -13.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0862 -12.6596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6692 -12.6615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6732 -11.8435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9679 -11.4329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2582 -11.8391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2582 -12.6602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9641 -13.0671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7445 -11.8493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4522 -11.4407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.1599 -11.8493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8800 -11.4407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.1599 -12.6665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 1 1 1
3 4 1 0
3 5 1 0
5 6 2 0
5 7 1 0
4 8 1 0
8 9 1 0
8 10 2 0
2 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
12 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
9 19 2 0
19 20 1 0
20 21 2 0
21 25 1 0
24 22 1 0
22 23 2 0
23 20 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 24 2 0
7 30 1 0
30 31 1 0
31 32 1 0
32 33 2 0
32 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.51Molecular Weight (Monoisotopic): 468.1897AlogP: 2.04#Rotatable Bonds: 9Polar Surface Area: 111.24Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.84CX Basic pKa: ┄CX LogP: 1.66CX LogD: 1.66Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.34Np Likeness Score: -0.26
References 1. Ieda N, Itoh K, Inoue Y, Izumiya Y, Kawaguchi M, Miyata N, Nakagawa H.. (2019) An irreversible inhibitor of peptidyl-prolyl cis/trans isomerase Pin1 and evaluation of cytotoxicity., 29 (3): [PMID:30585173 ] [10.1016/j.bmcl.2018.12.044 ]