N-(3-(1H-Imidazol-1-yl)propyl)-6-(4-methoxy-2-methylphenyl)-3-(1,3,4-oxadiazol-2-yl)quinolin-4-amine

ID: ALA4519022

PubChem CID: 153370129

Max Phase: Preclinical

Molecular Formula: C25H24N6O2

Molecular Weight: 440.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2ccc3ncc(-c4nnco4)c(NCCCn4ccnc4)c3c2)c(C)c1

Standard InChI:  InChI=1S/C25H24N6O2/c1-17-12-19(32-2)5-6-20(17)18-4-7-23-21(13-18)24(22(14-28-23)25-30-29-16-33-25)27-8-3-10-31-11-9-26-15-31/h4-7,9,11-16H,3,8,10H2,1-2H3,(H,27,28)

Standard InChI Key:  HMHTXEJFIVOEEV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   17.8488  -14.4288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8477  -15.2483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5557  -15.6573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5540  -14.0199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2626  -14.4252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2633  -15.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9719  -15.6512    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.6801  -15.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6754  -14.4183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9663  -14.0149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3797  -14.0030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1283  -14.3308    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.6714  -13.7202    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2585  -13.0149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4602  -13.1898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9620  -13.1977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2521  -12.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1431  -14.0205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1443  -13.2022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4373  -12.7939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7287  -13.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7315  -14.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4391  -14.4287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2478  -11.9757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5379  -11.5709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5336  -10.7537    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1886  -10.2694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9319   -9.4935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1147   -9.4979    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8664  -10.2764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4415  -15.2459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0203  -12.7952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0191  -11.9780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 11  1  0
  9 11  1  0
 10 16  1  0
 16 17  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  1 18  1  0
 17 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 26  1  0
 23 31  1  0
 21 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4519022

    ---

Associated Targets(Human)

TOP1 Tclin DNA topoisomerase I (7553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 440.51Molecular Weight (Monoisotopic): 440.1961AlogP: 4.97#Rotatable Bonds: 8
Polar Surface Area: 90.89Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.00CX LogP: 2.58CX LogD: 2.44
Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -1.38

References

1. Kundu B, Das SK, Paul Chowdhuri S, Pal S, Sarkar D, Ghosh A, Mukherjee A, Bhattacharya D, Das BB, Talukdar A..  (2019)  Discovery and Mechanistic Study of Tailor-Made Quinoline Derivatives as Topoisomerase 1 Poison with Potent Anticancer Activity.,  62  (7): [PMID:30897325] [10.1021/acs.jmedchem.8b01938]

Source