The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(5-Cyclododecylthiophene-2-carbonyl)-L-arginine ID: ALA4519060
PubChem CID: 155541887
Max Phase: Preclinical
Molecular Formula: C23H38N4O3S
Molecular Weight: 450.65
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NCCC[C@H](NC(=O)c1ccc(C2CCCCCCCCCCC2)s1)C(=O)O
Standard InChI: InChI=1S/C23H38N4O3S/c24-23(25)26-16-10-13-18(22(29)30)27-21(28)20-15-14-19(31-20)17-11-8-6-4-2-1-3-5-7-9-12-17/h14-15,17-18H,1-13,16H2,(H,27,28)(H,29,30)(H4,24,25,26)/t18-/m0/s1
Standard InChI Key: PMJAUPAXAWBGEZ-SFHVURJKSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
3.5937 -14.2531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1752 -14.9549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4108 -14.2598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8052 -14.9754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5935 -16.4039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0150 -15.7038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6201 -14.9864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5739 -15.6596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1574 -16.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5463 -17.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3562 -17.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7772 -16.3810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3945 -16.2971 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.1325 -15.9462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0287 -15.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2229 -14.9848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8350 -15.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8497 -16.3378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8692 -17.1548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5516 -15.9125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2689 -16.3041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9667 -15.8788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2883 -17.1211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5905 -17.5464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0056 -17.5127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9472 -15.0618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6408 -14.6365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6214 -13.8195 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3192 -13.3942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2997 -12.5773 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0364 -13.7858 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
2 8 1 0
4 3 1 0
4 7 1 0
12 5 1 0
5 6 1 0
6 7 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 13 1 0
14 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 1 1
21 23 1 0
23 24 1 0
23 25 2 0
22 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
17 6 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.65Molecular Weight (Monoisotopic): 450.2665AlogP: 4.58#Rotatable Bonds: 8Polar Surface Area: 128.30Molecular Species: ZWITTERIONHBA: 4HBD: 5#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.72CX Basic pKa: 11.99CX LogP: 3.37CX LogD: 3.37Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.22Np Likeness Score: -0.22
References 1. Rowley JA, Reid RC, Poon EKY, Wu KC, Lim J, Lohman RJ, Hamidon JK, Yau MK, Halili MA, Durek T, Iyer A, Fairlie DP.. (2020) Potent Thiophene Antagonists of Human Complement C3a Receptor with Anti-Inflammatory Activity., 63 (2): [PMID:31910011 ] [10.1021/acs.jmedchem.9b00927 ]