(N-(6-((4-tert-Butylbenzyl)(pyridin-3-ylsulfonyl)-aminomethyl)pyridin-2-yl)-N-methylamino)acetic Acid Hydrochloride

ID: ALA4519118

PubChem CID: 155541718

Max Phase: Preclinical

Molecular Formula: C25H31ClN4O4S

Molecular Weight: 482.61

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(CC(=O)O)c1cccc(CN(Cc2ccc(C(C)(C)C)cc2)S(=O)(=O)c2cccnc2)n1.Cl

Standard InChI:  InChI=1S/C25H30N4O4S.ClH/c1-25(2,3)20-12-10-19(11-13-20)16-29(34(32,33)22-8-6-14-26-15-22)17-21-7-5-9-23(27-21)28(4)18-24(30)31;/h5-15H,16-18H2,1-4H3,(H,30,31);1H

Standard InChI Key:  OHTBPAKFFJTPBA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 36  0  0  0  0  0  0  0  0999 V2000
   18.4741  -13.7009    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   14.6834  -15.2042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8583  -15.2042    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.2709  -15.9186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7194  -15.6250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7182  -16.4523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4331  -16.8652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1453  -16.4518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1425  -15.6213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4312  -15.2122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8564  -14.3811    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5694  -13.9660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1404  -13.9713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1373  -13.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2854  -14.3757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8520  -12.7331    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4174  -11.9179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4237  -12.7407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2836  -15.2011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9988  -15.6108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7128  -15.1955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7069  -14.3663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9912  -13.9603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4292  -15.6044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4335  -16.4294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1417  -15.1882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1417  -16.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1327  -11.4982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8462  -11.9065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5585  -11.4901    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2752  -11.8987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9874  -11.4823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7041  -11.8909    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9829  -10.6574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5539  -10.6651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  4  3  2  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  9  3  1  0
  3 11  1  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
 12 15  1  0
 14 16  2  0
 16 29  1  0
 28 17  1  0
 17 18  2  0
 18 14  1  0
 15 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 15  1  0
 21 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 32 34  1  0
 30 35  1  0
M  END

Associated Targets(Human)

PTGER2 Tclin Prostanoid EP2 receptor (1730 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 482.61Molecular Weight (Monoisotopic): 482.1988AlogP: 3.69#Rotatable Bonds: 9
Polar Surface Area: 103.70Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.16CX Basic pKa: 5.51CX LogP: 1.70CX LogD: 0.87
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.50Np Likeness Score: -1.68

References

1. Iwamura R, Tanaka M, Okanari E, Kirihara T, Odani-Kawabata N, Shams N, Yoneda K..  (2018)  Identification of a Selective, Non-Prostanoid EP2 Receptor Agonist for the Treatment of Glaucoma: Omidenepag and its Prodrug Omidenepag Isopropyl.,  61  (15): [PMID:29995405] [10.1021/acs.jmedchem.8b00808]

Source