6-(1,3-benzodioxol-5-yl)-3-(benzylthio)-6,7-dihydro[1,2,4]triazino[5,6-d][3,1]benzoxazepine

ID: ALA4519243

PubChem CID: 6410235

Max Phase: Preclinical

Molecular Formula: C24H18N4O3S

Molecular Weight: 442.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc(CSc2nnc3c(n2)OC(c2ccc4c(c2)OCO4)Nc2ccccc2-3)cc1

Standard InChI:  InChI=1S/C24H18N4O3S/c1-2-6-15(7-3-1)13-32-24-26-23-21(27-28-24)17-8-4-5-9-18(17)25-22(31-23)16-10-11-19-20(12-16)30-14-29-19/h1-12,22,25H,13-14H2

Standard InChI Key:  VQCNCZNFZABMHI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 37  0  0  0  0  0  0  0  0999 V2000
    9.3750   -5.9732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1170   -6.3397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2955   -7.1445    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7728   -7.7821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9476   -7.7759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5314   -8.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9392   -9.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7677   -9.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1801   -8.4947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4370   -7.1247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6307   -6.3205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0318   -5.7526    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2390   -5.9877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0484   -6.7959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6487   -7.3603    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7653   -5.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5319   -6.1407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1811   -5.6319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6480   -5.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2940   -4.5067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0638   -4.8113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5915   -4.1731    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1476   -3.4741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3458   -3.6804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6388   -5.4207    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.8476   -5.6569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2475   -5.0899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4427   -4.2893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8434   -3.7226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0513   -3.9586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8620   -4.7666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4627   -5.3298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 11  1  1  0
  1  2  1  0
  2  3  1  0
 10  5  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 16 17  2  0
 17 18  1  0
 18 21  2  0
 20 19  2  0
 19 16  1  0
  2 16  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 20  1  0
 13 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Associated Targets(Human)

RAD52 Tchem DNA repair protein RAD52 homolog (856 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 442.50Molecular Weight (Monoisotopic): 442.1100AlogP: 5.06#Rotatable Bonds: 4
Polar Surface Area: 78.39Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.69CX Basic pKa: 0.67CX LogP: 5.44CX LogD: 5.44
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -1.09

References

1.  (2018)  HTS Assay for Identifying Small Molecule Inhibitors of RAD52 and Uses of Identified Small Molecule Inhibitors for Treatment and Prevention of BRCA-Deficient Malignancies, 

Source