The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
13-epi-higginsianin C ID: ALA4519308
PubChem CID: 145720805
Max Phase: Preclinical
Molecular Formula: C27H40O5
Molecular Weight: 444.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C1CC[C@@H]2[C@](C)(CC[C@H]3O[C@@H](C(C)(C)O)CC[C@@]23C)[C@@H]1Cc1c(O)c(C)c(C)oc1=O
Standard InChI: InChI=1S/C27H40O5/c1-15-8-9-20-26(6,19(15)14-18-23(28)16(2)17(3)31-24(18)29)12-11-22-27(20,7)13-10-21(32-22)25(4,5)30/h19-22,28,30H,1,8-14H2,2-7H3/t19-,20-,21-,22-,26-,27+/m1/s1
Standard InChI Key: WJLHNBLWQUYSAS-VDCPFADWSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
18.9350 -4.5015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5284 -5.2141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3497 -5.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2988 -2.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2988 -3.5689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7142 -2.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0044 -2.3323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7142 -3.5689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0048 -3.9761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0021 -4.7846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7061 -5.1992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4167 -3.9742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4134 -4.7907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1129 -5.1997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8224 -4.7992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8297 -3.9827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1235 -3.5668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6274 -3.1769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4052 -5.6061 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
18.5263 -6.0332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5836 -2.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5862 -3.9790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5878 -4.8005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2904 -4.3820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1160 -2.8563 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.2989 -5.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2993 -6.0263 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5936 -6.4422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8807 -6.0326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8736 -5.2112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1628 -4.8011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1702 -6.4463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5957 -7.2637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1161 -5.2101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
4 7 1 0
5 9 1 0
8 6 1 0
6 7 1 0
8 9 1 0
8 12 1 0
9 10 1 0
10 11 1 0
11 13 1 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
12 18 1 1
13 19 1 1
15 2 1 6
2 20 1 0
4 21 2 0
5 22 1 6
22 23 1 0
9 24 1 1
8 25 1 6
23 26 1 0
23 30 2 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 1 0
29 32 1 0
28 33 1 0
26 34 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.61Molecular Weight (Monoisotopic): 444.2876AlogP: 5.21#Rotatable Bonds: 3Polar Surface Area: 79.90Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.67CX Basic pKa: ┄CX LogP: 4.51CX LogD: 4.32Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.63Np Likeness Score: 2.47
References 1. Dallery JF, Le Goff G, Adelin E, Iorga BI, Pigné S, O'Connell RJ, Ouazzani J.. (2019) Deleting a Chromatin Remodeling Gene Increases the Diversity of Secondary Metabolites Produced by Colletotrichum higginsianum., 82 (4): [PMID:30776231 ] [10.1021/acs.jnatprod.8b00796 ]