The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N'-isonicotinoyl-2-methyl-4-(pyridin-2-yl)-4H-benzo[4,5]thiazolo[3,2-a]pyrimidine-3-carbohydrazide ID: ALA4519554
PubChem CID: 155541803
Max Phase: Preclinical
Molecular Formula: C23H18N6O2S
Molecular Weight: 442.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(C(=O)NNC(=O)c2ccncc2)C(c2ccccn2)N2C(=N1)Sc1ccccc12
Standard InChI: InChI=1S/C23H18N6O2S/c1-14-19(22(31)28-27-21(30)15-9-12-24-13-10-15)20(16-6-4-5-11-25-16)29-17-7-2-3-8-18(17)32-23(29)26-14/h2-13,20H,1H3,(H,27,30)(H,28,31)
Standard InChI Key: ISLVNNAYNPDFLA-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
5.6827 -5.7988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3880 -5.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3880 -4.5771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6827 -4.1644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9774 -5.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9775 -4.5771 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2003 -5.6467 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.7199 -4.9857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2008 -4.3262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8700 -3.5821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0585 -3.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5790 -4.1606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9125 -4.9020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0951 -5.8039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0969 -4.1706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8034 -4.5812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0993 -3.3534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5123 -4.1747 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2188 -4.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9277 -4.1789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2164 -5.4026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6311 -4.5929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3395 -4.1871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3423 -3.3690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6308 -2.9585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9253 -3.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6831 -3.3480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3924 -2.9400 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3928 -2.1236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6845 -1.7142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9745 -2.1272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9776 -2.9422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 4 1 0
5 1 2 0
1 2 1 0
2 3 2 0
3 4 1 0
5 6 1 0
6 9 1 0
8 7 1 0
7 5 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
2 14 1 0
3 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 20 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
4 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.50Molecular Weight (Monoisotopic): 442.1212AlogP: 3.23#Rotatable Bonds: 3Polar Surface Area: 99.58Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.04CX Basic pKa: 3.47CX LogP: 2.07CX LogD: 2.06Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.60Np Likeness Score: -1.53
References 1. Bhoi MN, Borad MA, Jethava DJ, Acharya PT, Pithawala EA, Patel CN, Pandya HA, Patel HD.. (2019) Synthesis, biological evaluation and computational study of novel isoniazid containing 4H-Pyrimido[2,1-b]benzothiazoles derivatives., 177 [PMID:31129451 ] [10.1016/j.ejmech.2019.05.028 ]