The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(3-methoxyphenoxy)-6-[2-(5-methylsulfanylpyrimidin-2-yl)oxyethoxy]-N-(propylsulfamoyl)pyrimidin-4-amine ID: ALA4519822
PubChem CID: 155542285
Max Phase: Preclinical
Molecular Formula: C21H26N6O6S2
Molecular Weight: 522.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCNS(=O)(=O)Nc1ncnc(OCCOc2ncc(SC)cn2)c1Oc1cccc(OC)c1
Standard InChI: InChI=1S/C21H26N6O6S2/c1-4-8-26-35(28,29)27-19-18(33-16-7-5-6-15(11-16)30-2)20(25-14-24-19)31-9-10-32-21-22-12-17(34-3)13-23-21/h5-7,11-14,26H,4,8-10H2,1-3H3,(H,24,25,27)
Standard InChI Key: VNLAEVZRIYGZCY-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
2.7116 -13.1163 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1243 -13.8262 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.5327 -13.1138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1311 -15.4606 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1300 -16.2801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8380 -16.6891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5477 -16.2796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5449 -15.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8363 -15.0517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8338 -14.2345 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4184 -14.2387 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2561 -16.6871 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2573 -17.5043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9657 -17.9118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9670 -18.7290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6753 -19.1365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6723 -19.9521 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3798 -20.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0878 -19.9497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0839 -19.1283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3758 -18.7246 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2510 -15.0457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7967 -20.3563 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.5032 -19.9456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9603 -15.4516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9600 -16.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6684 -16.6723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3756 -16.2610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3699 -15.4396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6609 -15.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7086 -13.8339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0030 -14.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2932 -13.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0746 -15.0259 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7852 -15.4293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
10 2 1 0
2 11 1 0
7 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
8 22 1 0
19 23 1 0
23 24 1 0
22 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
11 31 1 0
31 32 1 0
32 33 1 0
29 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 522.61Molecular Weight (Monoisotopic): 522.1355AlogP: 2.90#Rotatable Bonds: 14Polar Surface Area: 146.68Molecular Species: NEUTRALHBA: 11HBD: 2#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.26CX Basic pKa: 3.12CX LogP: 2.47CX LogD: 2.16Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.24Np Likeness Score: -1.13
References 1. Boss C, Bolli MH, Gatfield J.. (2016) From bosentan (Tracleer®) to macitentan (Opsumit®): The medicinal chemistry perspective., 26 (15): [PMID:27321813 ] [10.1016/j.bmcl.2016.06.014 ]