N1-methyl-N2-(15-(5-oxo-4,5-dihydro-1,2,4-oxadiazol-3-yl)pentadec-5(Z)-en-1-yl)oxalamide

ID: ALA4519824

PubChem CID: 155542287

Max Phase: Preclinical

Molecular Formula: C20H34N4O4

Molecular Weight: 394.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNC(=O)C(=O)NCCCC/C=C\CCCCCCCCCc1noc(=O)[nH]1

Standard InChI:  InChI=1S/C20H34N4O4/c1-21-18(25)19(26)22-16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-17-23-20(27)28-24-17/h6,8H,2-5,7,9-16H2,1H3,(H,21,25)(H,22,26)(H,23,24,27)/b8-6-

Standard InChI Key:  CZRLUVTWHXAIHM-VURMDHGXSA-N

Molfile:  

 
     RDKit          2D

 28 28  0  0  0  0  0  0  0  0999 V2000
   24.4868   -4.5193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3040   -4.5193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0783   -5.2270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2611   -5.2270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8525   -5.9347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2611   -6.6424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7126   -5.2270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5298   -5.2270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0783   -6.6424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4868   -5.9347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3040   -5.9347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7126   -6.6424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5298   -6.6424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9384   -7.3501    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.7556   -7.3501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1642   -8.0579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1642   -6.6424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.9814   -8.0579    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.3900   -8.7656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9384   -4.5193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7556   -4.5193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7556   -8.7656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.1642   -3.8116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9766   -3.7238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.1465   -2.9245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4388   -2.5159    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.8316   -3.0627    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.8931   -2.5921    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  2  7  1  0
  7  8  1  0
  6  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 18 19  1  0
  8 20  1  0
 20 21  1  0
 16 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 23  2  0
 25 28  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4519824

    ---

Associated Targets(Human)

EPHX2 Tchem Epoxide hydratase (3844 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 394.52Molecular Weight (Monoisotopic): 394.2580AlogP: 2.61#Rotatable Bonds: 15
Polar Surface Area: 117.09Molecular Species: ACIDHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 6.04CX Basic pKa: CX LogP: 3.58CX LogD: 2.76
Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.24Np Likeness Score: -0.38

References

1. Adebesin AM, Wesser T, Vijaykumar J, Konkel A, Paudyal MP, Lossie J, Zhu C, Westphal C, Puli N, Fischer R, Schunck WH, Falck JR..  (2019)  Development of Robust 17(R),18(S)-Epoxyeicosatetraenoic Acid (17,18-EEQ) Analogues as Potential Clinical Antiarrhythmic Agents.,  62  (22): [PMID:31693857] [10.1021/acs.jmedchem.9b00952]

Source