The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Paspalinine-13-ene ID: ALA4519852
PubChem CID: 145721019
Max Phase: Preclinical
Molecular Formula: C27H29NO3
Molecular Weight: 415.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)O[C@@]23CC[C@@]4(C)C(=CC[C@H]5Cc6c([nH]c7ccccc67)[C@@]54C)C2=CC(=O)[C@@H]1O3
Standard InChI: InChI=1S/C27H29NO3/c1-24(2)23-21(29)14-19-18-10-9-15-13-17-16-7-5-6-8-20(16)28-22(17)26(15,4)25(18,3)11-12-27(19,30-23)31-24/h5-8,10,14-15,23,28H,9,11-13H2,1-4H3/t15-,23-,25-,26+,27-/m0/s1
Standard InChI Key: JLENOOOPKJFMMJ-MQEXBILOSA-N
Molfile:
RDKit 2D
33 39 0 0 0 0 0 0 0 0999 V2000
19.5094 -5.2829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6922 -5.2829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1008 -5.9906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5737 -2.3840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8590 -1.9680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5725 -3.2091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8534 -3.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8456 -4.4365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5551 -4.8578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2838 -3.6243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2723 -4.4489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9768 -4.8687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6972 -4.4687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7086 -3.6441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9997 -3.2196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4224 -3.2461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2642 -5.2622 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1465 -3.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1518 -2.3829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3695 -2.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4400 -4.3171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9282 -3.9952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1469 -1.5642 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.3610 -3.4567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8841 -2.7857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8701 -4.1176 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0899 -3.8551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0998 -3.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3930 -2.6136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6758 -3.0172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6699 -3.8435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3773 -4.2582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5135 -4.4657 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
19 5 1 0
18 7 1 0
6 4 2 0
4 5 1 0
6 7 1 0
6 10 1 0
7 8 1 0
8 9 1 0
9 11 1 0
10 11 1 0
10 15 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
11 17 1 1
13 2 1 0
17 2 1 0
18 19 1 0
19 20 1 0
20 25 1 0
24 18 1 0
7 21 1 1
18 22 1 6
19 23 1 1
24 25 2 0
25 28 1 0
27 26 1 0
26 24 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
13 33 1 6
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 415.53Molecular Weight (Monoisotopic): 415.2147AlogP: 5.13#Rotatable Bonds: ┄Polar Surface Area: 51.32Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.96CX LogD: 4.96Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.65Np Likeness Score: 2.23
References 1. Ariantari NP, Ancheeva E, Wang C, Mándi A, Knedel TO, Kurtán T, Chaidir C, Müller WEG, Kassack MU, Janiak C, Daletos G, Proksch P.. (2019) Indole Diterpenoids from an Endophytic Penicillium sp., 82 (6): [PMID:31117519 ] [10.1021/acs.jnatprod.8b00723 ]