25-O-methyl alisol A

ID: ALA4519986

Cas Number: 155801-00-6

PubChem CID: 102004721

Max Phase: Preclinical

Molecular Formula: C31H52O5

Molecular Weight: 504.75

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(C)(C)[C@H](O)[C@@H](O)C[C@@H](C)C1=C2C[C@H](O)[C@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@]3(C)[C@@]2(C)CC1

Standard InChI:  InChI=1S/C31H52O5/c1-18(16-22(33)26(35)28(4,5)36-9)19-10-14-30(7)20(19)17-21(32)25-29(6)13-12-24(34)27(2,3)23(29)11-15-31(25,30)8/h18,21-23,25-26,32-33,35H,10-17H2,1-9H3/t18-,21+,22+,23+,25+,26-,29+,30+,31+/m1/s1

Standard InChI Key:  GSXGAZVWBLDJCJ-HQLNBPMCSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   26.8559  -14.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4514  -13.6281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0383  -14.3354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7457  -12.3982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7457  -13.2195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4551  -11.9855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1603  -12.3982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1569  -13.2195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8631  -13.6329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5772  -13.2255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8700  -11.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5768  -12.4067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5936  -10.7678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8753  -11.1717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3004  -11.1883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2870  -12.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0609  -12.2703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8629  -12.8109    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   27.1530  -11.5769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5687  -11.5851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1489  -14.0367    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.0344  -13.6333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.2827  -12.8192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0825  -10.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5529  -11.6144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3469  -10.1764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1488  -10.0187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6862  -10.6343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4881  -10.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0255  -11.0922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7524   -9.7034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.7611  -11.8654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8273  -10.9345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8095   -9.5608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4218  -11.4075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.4264  -11.7956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.1712  -10.7568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.0139  -12.5010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  6  1  0
  5  2  1  0
  2  8  1  0
  7  6  1  0
  7  8  1  0
  7 11  1  0
  8  9  1  0
  9 10  1  0
 10 12  1  0
 11 12  1  0
 11 14  1  0
 12 16  1  0
 15 13  1  0
 13 14  1  0
 15 16  1  0
 16 17  1  0
 17 25  1  0
 24 15  2  0
 11 18  1  1
  7 19  1  1
 12 20  1  6
  8 21  1  6
  5 22  2  0
 16 23  1  1
 24 25  1  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  1  1
 30 32  1  0
 30 33  1  0
 26 34  1  6
 28 35  1  1
 30 36  1  0
 14 37  1  1
 36 38  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

NR1H4 Tclin Bile acid receptor FXR (6228 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 504.75Molecular Weight (Monoisotopic): 504.3815AlogP: 5.45#Rotatable Bonds: 6
Polar Surface Area: 86.99Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.05CX Basic pKa: CX LogP: 4.39CX LogD: 4.39
Aromatic Rings: Heavy Atoms: 36QED Weighted: 0.42Np Likeness Score: 3.23

References

1. Luan ZL, Huo XK, Dong PP, Tian XG, Sun CP, Lv X, Feng L, Ning J, Wang C, Zhang BJ, Ma XC..  (2019)  Highly potent non-steroidal FXR agonists protostane-type triterpenoids: Structure-activity relationship and mechanism.,  182  [PMID:31494470] [10.1016/j.ejmech.2019.111652]

Source