1-ethyl-7-(naphthalen-1-yloxy)-1,3-dihydro-2H-benzo[d]imidazol-2-one

ID: ALA4519998

PubChem CID: 145999190

Max Phase: Preclinical

Molecular Formula: C19H16N2O2

Molecular Weight: 304.35

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCn1c(=O)[nH]c2cccc(Oc3cccc4ccccc34)c21

Standard InChI:  InChI=1S/C19H16N2O2/c1-2-21-18-15(20-19(21)22)10-6-12-17(18)23-16-11-5-8-13-7-3-4-9-14(13)16/h3-12H,2H2,1H3,(H,20,22)

Standard InChI Key:  SAWNOVYQJFNEAZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 26  0  0  0  0  0  0  0  0999 V2000
   42.8887  -11.6222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8876  -12.4418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5956  -12.8507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5939  -11.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3025  -11.6186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3073  -12.4373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0873  -12.6857    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.5647  -12.0206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0795  -11.3612    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   46.3818  -12.0158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.5914  -10.3962    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.8825   -9.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4678   -9.1776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4729   -9.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1816  -10.4017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3275  -10.5825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.1258  -10.4079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1753   -8.7669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8812   -9.1766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5869   -8.7703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5879   -7.9543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8774   -7.5464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1746   -7.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  8 10  2  0
  4 11  1  0
 11 12  1  0
 12 19  2  0
 18 13  2  0
 13 14  1  0
 14 15  2  0
 15 12  1  0
  9 16  1  0
 16 17  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4519998

    ---

Associated Targets(Human)

HEK-293T (167025 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

pol Human immunodeficiency virus type 1 reverse transcriptase (18245 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 304.35Molecular Weight (Monoisotopic): 304.1212AlogP: 4.30#Rotatable Bonds: 3
Polar Surface Area: 47.02Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.73CX Basic pKa: CX LogP: 4.04CX LogD: 4.04
Aromatic Rings: 4Heavy Atoms: 23QED Weighted: 0.61Np Likeness Score: -0.57

References

1. Pribut N, Basson AE, van Otterlo WAL, Liotta DC, Pelly SC..  (2019)  Aryl Substituted Benzimidazolones as Potent HIV-1 Non-Nucleoside Reverse Transcriptase Inhibitors.,  10  (2): [PMID:30783503] [10.1021/acsmedchemlett.8b00549]

Source