(E)-N-(4-hydroxy-3-methoxybenzyl)-3-(2,3,4-trimethoxyphenyl)acrylamide

ID: ALA4520001

PubChem CID: 155542235

Max Phase: Preclinical

Molecular Formula: C20H23NO6

Molecular Weight: 373.41

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(CNC(=O)/C=C/c2ccc(OC)c(OC)c2OC)ccc1O

Standard InChI:  InChI=1S/C20H23NO6/c1-24-16-9-6-14(19(26-3)20(16)27-4)7-10-18(23)21-12-13-5-8-15(22)17(11-13)25-2/h5-11,22H,12H2,1-4H3,(H,21,23)/b10-7+

Standard InChI Key:  NIDBPXPOXHSAMF-JXMROGBWSA-N

Molfile:  

 
     RDKit          2D

 27 28  0  0  0  0  0  0  0  0999 V2000
   38.5469  -24.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5458  -24.8400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2538  -25.2489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9635  -24.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9606  -24.0168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2520  -23.6116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6668  -23.6056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3760  -24.0115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0822  -23.6002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7914  -24.0062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.4976  -23.5949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2069  -24.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0791  -22.7831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.2071  -24.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9155  -25.2239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.6226  -24.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.6169  -23.9912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9079  -23.5891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.3324  -25.2176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   46.3216  -23.5775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   47.0323  -23.9809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6718  -25.2470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.6731  -26.0642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2536  -26.0661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.5458  -26.4745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8377  -25.2480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.1303  -24.8388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  9 13  2  0
 12 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 12  1  0
 16 19  1  0
 17 20  1  0
 20 21  1  0
  4 22  1  0
 22 23  1  0
  3 24  1  0
 24 25  1  0
  2 26  1  0
 26 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4520001

    ---

Associated Targets(Human)

SH-SY5Y (11521 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 373.41Molecular Weight (Monoisotopic): 373.1525AlogP: 2.76#Rotatable Bonds: 8
Polar Surface Area: 86.25Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.93CX Basic pKa: CX LogP: 2.34CX LogD: 2.34
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.69Np Likeness Score: 0.05

References

1. Zhang WX, Wang H, Cui HR, Guo WB, Zhou F, Cai DS, Xu B, Jia XH, Huang XM, Yang YQ, Chen HS, Qi JC, Wang PL, Lei HM..  (2019)  Design, synthesis and biological evaluation of cinnamic acid derivatives with synergetic neuroprotection and angiogenesis effect.,  183  [PMID:31541868] [10.1016/j.ejmech.2019.111695]

Source