The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(4-hydroxy-3-methoxybenzyl)-3-(2,3,4-trimethoxyphenyl)acrylamide ID: ALA4520001
PubChem CID: 155542235
Max Phase: Preclinical
Molecular Formula: C20H23NO6
Molecular Weight: 373.41
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CNC(=O)/C=C/c2ccc(OC)c(OC)c2OC)ccc1O
Standard InChI: InChI=1S/C20H23NO6/c1-24-16-9-6-14(19(26-3)20(16)27-4)7-10-18(23)21-12-13-5-8-15(22)17(11-13)25-2/h5-11,22H,12H2,1-4H3,(H,21,23)/b10-7+
Standard InChI Key: NIDBPXPOXHSAMF-JXMROGBWSA-N
Molfile:
RDKit 2D
27 28 0 0 0 0 0 0 0 0999 V2000
38.5469 -24.0204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5458 -24.8400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2538 -25.2489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9635 -24.8395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9606 -24.0168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2520 -23.6116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6668 -23.6056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3760 -24.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0822 -23.6002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7914 -24.0062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.4976 -23.5949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2069 -24.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0791 -22.7831 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.2071 -24.8181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9155 -25.2239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6226 -24.8126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6169 -23.9912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9079 -23.5891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.3324 -25.2176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
46.3216 -23.5775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
47.0323 -23.9809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6718 -25.2470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.6731 -26.0642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2536 -26.0661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.5458 -26.4745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8377 -25.2480 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1303 -24.8388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
9 13 2 0
12 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 12 1 0
16 19 1 0
17 20 1 0
20 21 1 0
4 22 1 0
22 23 1 0
3 24 1 0
24 25 1 0
2 26 1 0
26 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 373.41Molecular Weight (Monoisotopic): 373.1525AlogP: 2.76#Rotatable Bonds: 8Polar Surface Area: 86.25Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.93CX Basic pKa: ┄CX LogP: 2.34CX LogD: 2.34Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.69Np Likeness Score: 0.05
References 1. Zhang WX, Wang H, Cui HR, Guo WB, Zhou F, Cai DS, Xu B, Jia XH, Huang XM, Yang YQ, Chen HS, Qi JC, Wang PL, Lei HM.. (2019) Design, synthesis and biological evaluation of cinnamic acid derivatives with synergetic neuroprotection and angiogenesis effect., 183 [PMID:31541868 ] [10.1016/j.ejmech.2019.111695 ]