5-((1-(2-Chlorophenyl)-2-oxocyclohexyl)amino)-N-methylpentanamide

ID: ALA4520065

PubChem CID: 155542262

Max Phase: Preclinical

Molecular Formula: C18H25ClN2O2

Molecular Weight: 336.86

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNC(=O)CCCCNC1(c2ccccc2Cl)CCCCC1=O

Standard InChI:  InChI=1S/C18H25ClN2O2/c1-20-17(23)11-5-7-13-21-18(12-6-4-10-16(18)22)14-8-2-3-9-15(14)19/h2-3,8-9,21H,4-7,10-13H2,1H3,(H,20,23)

Standard InChI Key:  RDHQIIRZRYNNDG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
    2.3651  -20.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3640  -21.5097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0787  -21.9225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7951  -21.5092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7923  -20.6787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0770  -20.2696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0745  -19.4446    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.5026  -20.2635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2184  -20.6756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9292  -20.2640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9304  -19.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2145  -19.0266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4976  -19.4400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7820  -19.0294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4956  -21.0865    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2065  -21.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1995  -22.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9104  -22.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9033  -23.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6142  -23.9921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6072  -24.8169    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3322  -23.5856    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3181  -25.2355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
  5  8  1  0
 13 14  2  0
  8 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4520065

    ---

Associated Targets(non-human)

Grin1 Glutamate NMDA receptor (6467 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 336.86Molecular Weight (Monoisotopic): 336.1605AlogP: 3.18#Rotatable Bonds: 7
Polar Surface Area: 58.20Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.15CX LogP: 3.21CX LogD: 3.02
Aromatic Rings: 1Heavy Atoms: 23QED Weighted: 0.75Np Likeness Score: -0.29

References

1. Dimitrov IV, Harvey MG, Voss LJ, Sleigh JW, Bickerdike MJ, Denny WA..  (2019)  Ketamine esters and amides as short-acting anaesthetics: Structure-activity relationships for the side-chain.,  27  (7): [PMID:30792105] [10.1016/j.bmc.2019.02.010]

Source