The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-Carbamoyl-1H-1,2,3-triazol-1-yl)phenyl (2-(4-phenylpiperazin-1-yl)ethyl)carbamate ID: ALA4520184
PubChem CID: 155541938
Max Phase: Preclinical
Molecular Formula: C22H25N7O3
Molecular Weight: 435.49
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1cn(-c2cccc(OC(=O)NCCN3CCN(c4ccccc4)CC3)c2)nn1
Standard InChI: InChI=1S/C22H25N7O3/c23-21(30)20-16-29(26-25-20)18-7-4-8-19(15-18)32-22(31)24-9-10-27-11-13-28(14-12-27)17-5-2-1-3-6-17/h1-8,15-16H,9-14H2,(H2,23,30)(H,24,31)
Standard InChI Key: MPOOJAKMOBNILB-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
35.5134 -5.1342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5122 -5.9538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2203 -6.3627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9299 -5.9533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9271 -5.1306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2185 -4.7254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2161 -3.9082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.9225 -3.4975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9201 -2.6803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.6315 -3.9040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.3380 -3.4933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0469 -3.8997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7534 -3.4890 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.4585 -3.9007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1629 -3.4934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1647 -2.6759 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.4559 -2.2672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7453 -2.6761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8692 -2.2698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5769 -2.6806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2844 -2.2733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2855 -1.4552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5732 -1.0462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8685 -1.4559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8069 -6.3651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0606 -6.0321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5133 -6.6390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9214 -7.3471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.7208 -7.1777 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.7007 -6.5529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3689 -5.8061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.2198 -7.2137 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
16 19 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 25 1 0
2 25 1 0
27 30 1 0
30 31 2 0
30 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 435.49Molecular Weight (Monoisotopic): 435.2019AlogP: 1.28#Rotatable Bonds: 7Polar Surface Area: 118.61Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.10CX Basic pKa: 6.93CX LogP: 2.17CX LogD: 2.04Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.57Np Likeness Score: -2.00
References 1. Grillo A, Chemi G, Brogi S, Brindisi M, Relitti N, Fezza F, Fazio D, Castelletti L, Perdona E, Wong A, Lamponi S, Pecorelli A, Benedusi M, Fantacci M, Valoti M, Valacchi G, Micheli F, Novellino E, Campiani G, Butini S, Maccarrone M, Gemma S.. (2019) Development of novel multipotent compounds modulating endocannabinoid and dopaminergic systems., 183 [PMID:31518969 ] [10.1016/j.ejmech.2019.111674 ]