The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
diisopropyl (6-ethyl-2-methyl-4-oxothieno[2,3-d]pyrimidin-3(4H)-ylamino)(3-nitrophenyl)methylphosphonate ID: ALA4520243
PubChem CID: 155542110
Max Phase: Preclinical
Molecular Formula: C22H29N4O6PS
Molecular Weight: 508.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1cc2c(=O)n(NC(c3cccc([N+](=O)[O-])c3)P(=O)(OC(C)C)OC(C)C)c(C)nc2s1
Standard InChI: InChI=1S/C22H29N4O6PS/c1-7-18-12-19-21(34-18)23-15(6)25(22(19)27)24-20(16-9-8-10-17(11-16)26(28)29)33(30,31-13(2)3)32-14(4)5/h8-14,20,24H,7H2,1-6H3
Standard InChI Key: IFZNESASZGYOFI-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
29.6872 -6.0670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8700 -6.0670 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
29.2786 -6.7747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7400 -6.4989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.4538 -6.0854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4510 -5.2586 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7383 -4.8533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0279 -6.0858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0246 -5.2652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2482 -6.3454 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.7655 -5.6827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2411 -5.0158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7356 -4.0361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1567 -4.8464 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.8664 -5.2515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5721 -4.8394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2792 -5.2466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9844 -4.8352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9807 -4.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2660 -3.6122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5637 -4.0260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1648 -6.4808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4461 -6.9007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9484 -5.6868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5362 -4.9811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8700 -7.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0958 -6.7747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9129 -6.7747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2786 -8.1902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6872 -7.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0528 -7.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2573 -2.7929 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.5461 -2.3904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9615 -2.3783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
8 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
7 9 1 0
8 9 2 0
9 12 1 0
11 10 1 0
10 8 1 0
11 12 2 0
7 13 2 0
6 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
15 2 1 0
2 22 2 0
5 23 1 0
11 24 1 0
24 25 1 0
3 26 1 0
1 27 1 0
27 28 1 0
26 29 1 0
27 30 1 0
26 31 1 0
32 33 2 0
32 34 1 0
20 32 1 0
M CHG 2 32 1 34 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.54Molecular Weight (Monoisotopic): 508.1545AlogP: 5.52#Rotatable Bonds: 10Polar Surface Area: 125.59Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 3.06CX LogP: 4.79CX LogD: 4.79Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.22Np Likeness Score: -1.49
References 1. Ali EMH, Abdel-Maksoud MS, Oh CH.. (2019) Thieno[2,3-d]pyrimidine as a promising scaffold in medicinal chemistry: Recent advances., 27 (7): [PMID:30826188 ] [10.1016/j.bmc.2019.02.044 ]