Pauferrol C

ID: ALA4520281

PubChem CID: 72201605

Max Phase: Preclinical

Molecular Formula: C30H22O8

Molecular Weight: 510.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(/C=C/c1ccc(O)cc1)c1cc2c(cc1O)O[C@H](c1ccc(O)cc1)[C@H]2C(=O)c1ccc(O)cc1O

Standard InChI:  InChI=1S/C30H22O8/c31-18-6-1-16(2-7-18)3-12-24(34)22-14-23-27(15-26(22)36)38-30(17-4-8-19(32)9-5-17)28(23)29(37)21-11-10-20(33)13-25(21)35/h1-15,28,30-33,35-36H/b12-3+/t28-,30-/m1/s1

Standard InChI Key:  MGWMQOHFXYKLKX-GMZGTPOUSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   20.4820   -5.5758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4809   -6.3995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1930   -6.8085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1913   -5.1629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9040   -5.5722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9043   -6.3950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6870   -6.6478    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.1681   -5.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6866   -5.3150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9389   -4.5336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7563   -4.5317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.9894   -5.9809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4535   -3.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7926   -3.1243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3080   -2.4601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4904   -2.5462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1597   -3.3022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6422   -3.9633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3986   -6.6954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2192   -6.6954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6283   -5.9829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2151   -5.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3959   -5.2723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6096   -3.0400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0083   -1.8822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.4496   -5.9815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7701   -5.1633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7699   -4.3420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0583   -5.5762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0585   -6.3975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3468   -6.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6364   -6.3941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9292   -6.8021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9290   -7.6243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6418   -8.0367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3501   -7.6222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2178   -8.0382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7687   -6.8075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  9 10  1  6
 10 11  2  0
  8 12  1  1
 10 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 12 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 12  1  0
 14 24  1  0
 16 25  1  0
 21 26  1  0
  1 27  1  0
 27 28  2  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 34 37  1  0
  2 38  1  0
M  END

Associated Targets(Human)

TOP2A Tclin DNA topoisomerase II alpha (6317 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 510.50Molecular Weight (Monoisotopic): 510.1315AlogP: 5.21#Rotatable Bonds: 6
Polar Surface Area: 144.52Molecular Species: NEUTRALHBA: 8HBD: 5
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 6.97CX Basic pKa: CX LogP: 6.47CX LogD: 5.82
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.18Np Likeness Score: 1.00

References

1. Menezes JCJMDS, Diederich MF..  (2019)  Natural dimers of coumarin, chalcones, and resveratrol and the link between structure and pharmacology.,  182  [PMID:31494471] [10.1016/j.ejmech.2019.111637]

Source