The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Pauferrol C ID: ALA4520281
PubChem CID: 72201605
Max Phase: Preclinical
Molecular Formula: C30H22O8
Molecular Weight: 510.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(/C=C/c1ccc(O)cc1)c1cc2c(cc1O)O[C@H](c1ccc(O)cc1)[C@H]2C(=O)c1ccc(O)cc1O
Standard InChI: InChI=1S/C30H22O8/c31-18-6-1-16(2-7-18)3-12-24(34)22-14-23-27(15-26(22)36)38-30(17-4-8-19(32)9-5-17)28(23)29(37)21-11-10-20(33)13-25(21)35/h1-15,28,30-33,35-36H/b12-3+/t28-,30-/m1/s1
Standard InChI Key: MGWMQOHFXYKLKX-GMZGTPOUSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
20.4820 -5.5758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4809 -6.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1930 -6.8085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1913 -5.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9040 -5.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9043 -6.3950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6870 -6.6478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1681 -5.9812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6866 -5.3150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9389 -4.5336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7563 -4.5317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9894 -5.9809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4535 -3.8731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7926 -3.1243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3080 -2.4601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4904 -2.5462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1597 -3.3022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6422 -3.9633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3986 -6.6954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2192 -6.6954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6283 -5.9829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2151 -5.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3959 -5.2723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6096 -3.0400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0083 -1.8822 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4496 -5.9815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7701 -5.1633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7699 -4.3420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0583 -5.5762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0585 -6.3975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3468 -6.8063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6364 -6.3941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9292 -6.8021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9290 -7.6243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6418 -8.0367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3501 -7.6222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2178 -8.0382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7687 -6.8075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
9 10 1 6
10 11 2 0
8 12 1 1
10 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
12 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 12 1 0
14 24 1 0
16 25 1 0
21 26 1 0
1 27 1 0
27 28 2 0
27 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
34 37 1 0
2 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.50Molecular Weight (Monoisotopic): 510.1315AlogP: 5.21#Rotatable Bonds: 6Polar Surface Area: 144.52Molecular Species: NEUTRALHBA: 8HBD: 5#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.97CX Basic pKa: ┄CX LogP: 6.47CX LogD: 5.82Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.18Np Likeness Score: 1.00
References 1. Menezes JCJMDS, Diederich MF.. (2019) Natural dimers of coumarin, chalcones, and resveratrol and the link between structure and pharmacology., 182 [PMID:31494471 ] [10.1016/j.ejmech.2019.111637 ]