The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-fluoro-4-(7-methoxy-6-(3-(4-methylpiperazin-1-yl)propoxy)quinolin-4-yloxy)phenyl)-2-(trifluoromethyl)benzenesulfonamide ID: ALA4520339
PubChem CID: 67071545
Max Phase: Preclinical
Molecular Formula: C31H32F4N4O5S
Molecular Weight: 648.68
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2nccc(Oc3ccc(NS(=O)(=O)c4ccccc4C(F)(F)F)cc3F)c2cc1OCCCN1CCN(C)CC1
Standard InChI: InChI=1S/C31H32F4N4O5S/c1-38-13-15-39(16-14-38)12-5-17-43-29-19-22-25(20-28(29)42-2)36-11-10-26(22)44-27-9-8-21(18-24(27)32)37-45(40,41)30-7-4-3-6-23(30)31(33,34)35/h3-4,6-11,18-20,37H,5,12-17H2,1-2H3
Standard InChI Key: ZAHHSSLXUFWNMW-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 49 0 0 0 0 0 0 0 0999 V2000
13.6487 -18.5478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2443 -17.8420 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.8353 -18.5452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6051 -20.3183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6039 -21.1378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3120 -21.5468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3102 -19.9094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0188 -20.3147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0196 -21.1337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7281 -21.5408 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4364 -21.1300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4316 -20.3078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7225 -19.9045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7182 -19.0873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4237 -18.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1290 -19.0832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8340 -18.6715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8302 -17.8535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1153 -17.4488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4132 -17.8628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5351 -17.4402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9505 -17.4308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6578 -17.8394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3635 -17.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3610 -16.6108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6468 -16.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9439 -16.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2330 -16.2148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2266 -15.3976 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.5285 -16.6289 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.5220 -15.8032 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.7010 -17.4621 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.8959 -21.5459 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1885 -21.1367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8973 -19.9099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1896 -20.3186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4818 -19.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7742 -20.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0664 -19.9106 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0649 -19.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3611 -18.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6511 -19.0903 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6494 -19.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3576 -20.3213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9449 -18.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
21 2 1 0
2 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
27 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
20 32 1 0
5 33 1 0
33 34 1 0
4 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
39 44 1 0
40 41 1 0
41 42 1 0
42 43 1 0
43 44 1 0
42 45 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 648.68Molecular Weight (Monoisotopic): 648.2030AlogP: 6.01#Rotatable Bonds: 11Polar Surface Area: 93.23Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.10CX Basic pKa: 8.09CX LogP: 3.85CX LogD: 3.76Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.16Np Likeness Score: -1.51
References 1. Szabadkai I, Torka R, Garamvölgyi R, Baska F, Gyulavári P, Boros S, Illyés E, Choidas A, Ullrich A, Őrfi L.. (2018) Discovery of N-[4-(Quinolin-4-yloxy)phenyl]benzenesulfonamides as Novel AXL Kinase Inhibitors., 61 (14): [PMID:29928803 ] [10.1021/acs.jmedchem.8b00672 ]