The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2,2-Diphenyl-1,3-dioxolan-4-yl)-N-(2-phenoxyethyl)ethan-1-ammonium hydrogen oxalate ID: ALA4520390
PubChem CID: 155542074
Max Phase: Preclinical
Molecular Formula: C27H29NO7
Molecular Weight: 389.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)C(=O)O.c1ccc(OCCNCCC2COC(c3ccccc3)(c3ccccc3)O2)cc1
Standard InChI: InChI=1S/C25H27NO3.C2H2O4/c1-4-10-21(11-5-1)25(22-12-6-2-7-13-22)28-20-24(29-25)16-17-26-18-19-27-23-14-8-3-9-15-23;3-1(4)2(5)6/h1-15,24,26H,16-20H2;(H,3,4)(H,5,6)
Standard InChI Key: VGNBFDLCNBOBTA-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
39.9203 -6.0567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6341 -5.6446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3479 -6.0567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.6341 -4.8204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.2066 -5.6446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.9203 -6.8809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.9301 -3.5351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1216 -3.3716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5778 -3.9909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8387 -4.7744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6525 -4.9360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1969 -4.3162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4823 -2.9204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8069 -2.4352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7958 -3.1849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7019 -2.3621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8898 -2.1983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.0423 -3.5272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.8902 -1.6102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2161 -1.1309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4612 -1.4717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3834 -2.3006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0577 -2.7803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5130 -3.5911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2234 -3.1731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9405 -3.5794 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.6508 -3.1614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3681 -3.5676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0784 -3.1496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.7956 -3.5559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7975 -4.3802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5140 -4.7864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2253 -4.3683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2158 -3.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4989 -3.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 1 0
1 6 2 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
13 7 1 0
14 13 1 0
15 16 1 0
16 17 1 0
17 13 1 0
13 18 1 0
18 15 1 0
14 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 14 1 0
15 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 389.50Molecular Weight (Monoisotopic): 389.1991AlogP: 4.36#Rotatable Bonds: 9Polar Surface Area: 39.72Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.56CX LogP: 5.31CX LogD: 3.18Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.55Np Likeness Score: -0.06
References 1. Franchini S, Sorbi C, Linciano P, Carnevale G, Tait A, Ronsisvalle S, Buccioni M, Del Bello F, Cilia A, Pirona L, Denora N, Iacobazzi RM, Brasili L.. (2019) 1,3-Dioxane as a scaffold for potent and selective 5-HT1AR agonist with in-vivo anxiolytic, anti-depressant and anti-nociceptive activity., 176 [PMID:31112892 ] [10.1016/j.ejmech.2019.05.024 ]