The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[(4-tert-butylphenyl)methyl]-2-[(4-fluorophenyl)sulfonyl-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]-N-[4-(hydroxycarbamoyl)phenyl]acetamide ID: ALA4520400
Cas Number: 2361659-61-0
PubChem CID: 137628685
Product Number: A649085, Order Now?
Max Phase: Preclinical
Molecular Formula: C33H29F6N3O5S
Molecular Weight: 693.67
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)c1ccc(CN(C(=O)CN(Cc2c(F)c(F)c(F)c(F)c2F)S(=O)(=O)c2ccc(F)cc2)c2ccc(C(=O)NO)cc2)cc1
Standard InChI: InChI=1S/C33H29F6N3O5S/c1-33(2,3)21-8-4-19(5-9-21)16-42(23-12-6-20(7-13-23)32(44)40-45)26(43)18-41(48(46,47)24-14-10-22(34)11-15-24)17-25-27(35)29(37)31(39)30(38)28(25)36/h4-15,45H,16-18H2,1-3H3,(H,40,44)
Standard InChI Key: LTRKEOBJRDKIHB-UHFFFAOYSA-N
Molfile:
RDKit 2D
48 51 0 0 0 0 0 0 0 0999 V2000
8.1183 -15.6793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7138 -16.3892 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.5308 -16.3846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3023 -16.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0100 -15.9848 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5946 -15.9848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8869 -16.3934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5946 -15.1676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1792 -15.9848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1792 -15.1676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8904 -14.7629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8907 -13.9465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1825 -13.5370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4724 -13.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4755 -14.7651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8869 -17.2105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7177 -17.2105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0100 -15.1676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7177 -14.7590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4251 -15.1703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1323 -14.7624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1327 -13.9443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4200 -13.5359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7157 -13.9461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1767 -17.6171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1764 -18.4335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8846 -18.8429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5947 -18.4300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5915 -17.6149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0078 -17.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0074 -18.4339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7157 -18.8433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4257 -18.4303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4226 -17.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8865 -19.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1793 -20.0720 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5947 -20.0701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4710 -19.6644 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1814 -12.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8885 -12.3103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4731 -12.3122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1768 -11.8988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7168 -19.6605 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.0067 -13.5398 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.4236 -15.9875 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.8398 -15.1713 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.8399 -13.5348 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.4172 -12.7187 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 6 1 0
6 7 1 0
6 8 2 0
7 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
7 16 1 0
5 2 1 0
2 17 1 0
5 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
16 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 16 1 0
17 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 17 1 0
35 36 1 0
35 37 2 0
27 35 1 0
36 38 1 0
13 39 1 0
39 40 1 0
39 41 1 0
39 42 1 0
32 43 1 0
24 44 1 0
20 45 1 0
21 46 1 0
22 47 1 0
23 48 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 693.67Molecular Weight (Monoisotopic): 693.1732AlogP: 6.36#Rotatable Bonds: 10Polar Surface Area: 107.02Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.20CX Basic pKa: ┄CX LogP: 6.50CX LogD: 6.49Aromatic Rings: 4Heavy Atoms: 48QED Weighted: 0.07Np Likeness Score: -1.39
References 1. Shouksmith AE, Gawel JM, Nawar N, Sina D, Raouf YS, Bukhari S, He L, Johns AE, Manaswiyoungkul P, Olaoye OO, Cabral AD, Sedighi A, de Araujo ED, Gunning PT.. (2020) Class I/IIb-Selective HDAC Inhibitor Exhibits Oral Bioavailability and Therapeutic Efficacy in Acute Myeloid Leukemia., 11 (1): [PMID:31938464 ] [10.1021/acsmedchemlett.9b00471 ] 2. Shouksmith AE, Shah F, Grimard ML, Gawel JM, Raouf YS, Geletu M, Berger-Becvar A, de Araujo ED, Luchman HA, Heaton WL, Bakhshinyan D, Adile AA, Venugopal C, O'Hare T, Deininger MW, Singh SK, Konieczny SF, Weiss S, Fishel ML, Gunning PT.. (2019) Identification and Characterization of AES-135, a Hydroxamic Acid-Based HDAC Inhibitor That Prolongs Survival in an Orthotopic Mouse Model of Pancreatic Cancer., 62 (5): [PMID:30776234 ] [10.1021/acs.jmedchem.8b01957 ]