1-Isopropyl-N-((6-methyl-2-oxo-4-propyl-1,2-dihydropyridin-3-yl)methyl)-6-(5-(trifluoromethyl)pyridin-2-yl)-1H-indazole-4-carboxamide

ID: ALA4520484

PubChem CID: 155542049

Max Phase: Preclinical

Molecular Formula: C27H28F3N5O2

Molecular Weight: 511.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCc1cc(C)[nH]c(=O)c1CNC(=O)c1cc(-c2ccc(C(F)(F)F)cn2)cc2c1cnn2C(C)C

Standard InChI:  InChI=1S/C27H28F3N5O2/c1-5-6-17-9-16(4)34-26(37)21(17)13-32-25(36)20-10-18(11-24-22(20)14-33-35(24)15(2)3)23-8-7-19(12-31-23)27(28,29)30/h7-12,14-15H,5-6,13H2,1-4H3,(H,32,36)(H,34,37)

Standard InChI Key:  IJJZCKKWMJHZHV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   11.3053   -8.5251    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7875   -7.8664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3135   -7.1986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5339   -7.4502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8287   -7.0350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1199   -7.4411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1164   -8.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8217   -8.6693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5304   -8.2673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8363   -6.2178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1311   -5.8068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5451   -5.8158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5486   -4.9987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2650   -3.7754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2615   -4.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9667   -5.0036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6755   -4.6017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6790   -3.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9737   -3.3693    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9591   -5.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6643   -6.2360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3772   -5.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5597   -3.3643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3919   -3.3784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4000   -9.4774    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4035   -8.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6983   -8.2492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9895   -8.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9819   -9.4683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6872   -9.8835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5150   -9.3110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3041   -9.5234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9365   -9.8883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2668   -9.8692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6195  -10.2352    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.4713   -9.5586    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.1230  -10.7110    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  1  9  1  0
  4  9  2  0
 10 11  2  0
 10 12  1  0
  5 10  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 14 19  1  0
 20 21  1  0
 21 22  1  0
 16 20  1  0
 14 23  2  0
 18 24  1  0
 13 15  1  0
 12 13  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 25 30  2  0
  7 26  1  0
  1 31  1  0
 31 32  1  0
 31 33  1  0
 34 35  1  0
 34 36  1  0
 34 37  1  0
 29 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4520484

    ---

Associated Targets(Human)

EZH2 Tclin Histone-lysine N-methyltransferase EZH2 (2012 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
EZH1 Tchem Histone-lysine N-methyltransferase EZH1 (112 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 511.55Molecular Weight (Monoisotopic): 511.2195AlogP: 5.58#Rotatable Bonds: 7
Polar Surface Area: 92.67Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.63CX Basic pKa: 3.23CX LogP: 3.95CX LogD: 3.95
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.34Np Likeness Score: -1.51

References

1. Yang X, Li F, Konze KD, Meslamani J, Ma A, Brown PJ, Zhou MM, Arrowsmith CH, Kaniskan HÜ, Vedadi M, Jin J..  (2016)  Structure-Activity Relationship Studies for Enhancer of Zeste Homologue 2 (EZH2) and Enhancer of Zeste Homologue 1 (EZH1) Inhibitors.,  59  (16): [PMID:27468126] [10.1021/acs.jmedchem.6b00855]

Source