The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-Isopropyl-N-((6-methyl-2-oxo-4-propyl-1,2-dihydropyridin-3-yl)methyl)-6-(5-(trifluoromethyl)pyridin-2-yl)-1H-indazole-4-carboxamide ID: ALA4520484
PubChem CID: 155542049
Max Phase: Preclinical
Molecular Formula: C27H28F3N5O2
Molecular Weight: 511.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCc1cc(C)[nH]c(=O)c1CNC(=O)c1cc(-c2ccc(C(F)(F)F)cn2)cc2c1cnn2C(C)C
Standard InChI: InChI=1S/C27H28F3N5O2/c1-5-6-17-9-16(4)34-26(37)21(17)13-32-25(36)20-10-18(11-24-22(20)14-33-35(24)15(2)3)23-8-7-19(12-31-23)27(28,29)30/h7-12,14-15H,5-6,13H2,1-4H3,(H,32,36)(H,34,37)
Standard InChI Key: IJJZCKKWMJHZHV-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
11.3053 -8.5251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7875 -7.8664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3135 -7.1986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5339 -7.4502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8287 -7.0350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1199 -7.4411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1164 -8.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8217 -8.6693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5304 -8.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8363 -6.2178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1311 -5.8068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5451 -5.8158 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5486 -4.9987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2650 -3.7754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2615 -4.5926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9667 -5.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6755 -4.6017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6790 -3.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9737 -3.3693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9591 -5.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6643 -6.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3772 -5.8299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5597 -3.3643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3919 -3.3784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4000 -9.4774 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4035 -8.6602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6983 -8.2492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9895 -8.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9819 -9.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6872 -9.8835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5150 -9.3110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3041 -9.5234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9365 -9.8883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2668 -9.8692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6195 -10.2352 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.4713 -9.5586 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.1230 -10.7110 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
1 9 1 0
4 9 2 0
10 11 2 0
10 12 1 0
5 10 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
14 19 1 0
20 21 1 0
21 22 1 0
16 20 1 0
14 23 2 0
18 24 1 0
13 15 1 0
12 13 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
25 30 2 0
7 26 1 0
1 31 1 0
31 32 1 0
31 33 1 0
34 35 1 0
34 36 1 0
34 37 1 0
29 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 511.55Molecular Weight (Monoisotopic): 511.2195AlogP: 5.58#Rotatable Bonds: 7Polar Surface Area: 92.67Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.63CX Basic pKa: 3.23CX LogP: 3.95CX LogD: 3.95Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.34Np Likeness Score: -1.51
References 1. Yang X, Li F, Konze KD, Meslamani J, Ma A, Brown PJ, Zhou MM, Arrowsmith CH, Kaniskan HÜ, Vedadi M, Jin J.. (2016) Structure-Activity Relationship Studies for Enhancer of Zeste Homologue 2 (EZH2) and Enhancer of Zeste Homologue 1 (EZH1) Inhibitors., 59 (16): [PMID:27468126 ] [10.1021/acs.jmedchem.6b00855 ]