(8R,9S,13S,14R,15S)-N-ethyl-3-(3-(4-fluoropiperidin-1-yl)propoxy)-13-methyl-17-oxo-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene-15-carboxamide

ID: ALA4520503

PubChem CID: 71276381

Max Phase: Preclinical

Molecular Formula: C29H41FN2O3

Molecular Weight: 484.66

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCNC(=O)[C@H]1CC(=O)[C@@]2(C)CC[C@@H]3c4ccc(OCCCN5CCC(F)CC5)cc4CC[C@H]3[C@H]12

Standard InChI:  InChI=1S/C29H41FN2O3/c1-3-31-28(34)25-18-26(33)29(2)12-9-23-22-8-6-21(17-19(22)5-7-24(23)27(25)29)35-16-4-13-32-14-10-20(30)11-15-32/h6,8,17,20,23-25,27H,3-5,7,9-16,18H2,1-2H3,(H,31,34)/t23-,24-,25+,27-,29-/m1/s1

Standard InChI Key:  STCAZOUTSRLMGA-YFGKGCBZSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   36.3569  -28.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0710  -28.2238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3638  -26.9887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0745  -27.4074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0914  -25.7594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3692  -26.1655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8021  -26.1822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7888  -27.0051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5675  -27.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0637  -26.6121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5890  -25.9378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0666  -26.5835    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   36.3568  -27.8093    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   37.7807  -27.8258    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   37.7972  -25.3577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6548  -28.2178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6599  -27.3984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9533  -26.9881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2411  -27.3920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2400  -28.2147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9472  -28.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5278  -28.6266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.8164  -28.2132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1041  -28.6252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3927  -28.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3935  -27.3904    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.8073  -28.0561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2507  -28.6585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.6079  -28.2390    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.8518  -29.0243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6524  -29.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8582  -25.1607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.1061  -26.9846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1089  -26.1669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3999  -25.7516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6863  -26.1603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6818  -26.9842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4038  -24.9344    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
 17  3  1  0
 16  1  1  0
  1  2  1  0
  2  4  1  0
  3  4  1  0
  3  6  1  0
  4  8  1  0
  7  5  1  0
  5  6  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
  4 12  1  1
  3 13  1  6
  8 14  1  6
  7 15  1  1
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
  9 27  1  6
 27 28  2  0
 27 29  1  0
 29 30  1  0
 30 31  1  0
 11 32  2  0
 26 33  1  0
 26 37  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 35 38  1  0
M  END

Associated Targets(Human)

HRH3 Tclin Histamine H3 receptor (10389 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.66Molecular Weight (Monoisotopic): 484.3101AlogP: 4.68#Rotatable Bonds: 7
Polar Surface Area: 58.64Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.80CX LogP: 3.74CX LogD: 2.33
Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.57Np Likeness Score: 0.10

References

1. Ledneczki I, Némethy Z, Tapolcsányi P, Éles J, Greiner I, Gábor E, Varga B, Balázs O, Román V, Lévay G, Mahó S..  (2019)  Discovery of novel steroidal histamine H3 receptor antagonists/inverse agonists. Part 2. Versatile steroidal carboxamide derivatives.,  29  (20): [PMID:31492518] [10.1016/j.bmcl.2019.126643]

Source