4-(cyclopentyl(2,6-difluorobenzyl)amino)-6-morpholino-1,3,5-triazine-2-carbonitrile

ID: ALA4520591

PubChem CID: 155542219

Max Phase: Preclinical

Molecular Formula: C20H22F2N6O

Molecular Weight: 400.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1nc(N2CCOCC2)nc(N(Cc2c(F)cccc2F)C2CCCC2)n1

Standard InChI:  InChI=1S/C20H22F2N6O/c21-16-6-3-7-17(22)15(16)13-28(14-4-1-2-5-14)20-25-18(12-23)24-19(26-20)27-8-10-29-11-9-27/h3,6-7,14H,1-2,4-5,8-11,13H2

Standard InChI Key:  UMCGEJXMQAFGGC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   35.6893  -13.2528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8998  -14.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7145  -14.0845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0077  -13.3230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3740  -12.8090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1635   -9.5710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.1635  -10.3882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8688  -10.7927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5741  -10.3882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5741   -9.5710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8688   -9.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2812  -10.7979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2768  -11.6151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.9831  -12.0246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6924  -11.6170    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.6909  -10.7956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9841  -10.3897    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.3978  -10.3855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1047   -9.9755    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.9815  -12.8418    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.2730  -13.2490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2714  -14.0662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5617  -14.4722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5598  -15.2886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2673  -15.6994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9781  -15.2878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9765  -14.4727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5519  -13.8881    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   32.8553  -14.0614    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  7  1  0
  6 11  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  9 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 16 18  1  0
 18 19  3  0
 14 20  1  0
 20 21  1  0
 20  1  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 27 28  1  0
 23 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4520591

    ---

Associated Targets(Human)

CTSL Tclin Cathepsin L (3852 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 400.43Molecular Weight (Monoisotopic): 400.1823AlogP: 2.81#Rotatable Bonds: 5
Polar Surface Area: 78.17Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.58CX LogP: 5.01CX LogD: 5.01
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.76Np Likeness Score: -1.60

References

1. Meanwell NA..  (2018)  Fluorine and Fluorinated Motifs in the Design and Application of Bioisosteres for Drug Design.,  61  (14): [PMID:29400967] [10.1021/acs.jmedchem.7b01788]

Source