The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(cyclopentyl(2,6-difluorobenzyl)amino)-6-morpholino-1,3,5-triazine-2-carbonitrile ID: ALA4520591
PubChem CID: 155542219
Max Phase: Preclinical
Molecular Formula: C20H22F2N6O
Molecular Weight: 400.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1nc(N2CCOCC2)nc(N(Cc2c(F)cccc2F)C2CCCC2)n1
Standard InChI: InChI=1S/C20H22F2N6O/c21-16-6-3-7-17(22)15(16)13-28(14-4-1-2-5-14)20-25-18(12-23)24-19(26-20)27-8-10-29-11-9-27/h3,6-7,14H,1-2,4-5,8-11,13H2
Standard InChI Key: UMCGEJXMQAFGGC-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
35.6893 -13.2528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8998 -14.0411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7145 -14.0845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0077 -13.3230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3740 -12.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1635 -9.5710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.1635 -10.3882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8688 -10.7927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5741 -10.3882 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5741 -9.5710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8688 -9.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2812 -10.7979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2768 -11.6151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.9831 -12.0246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6924 -11.6170 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.6909 -10.7956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9841 -10.3897 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.3978 -10.3855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1047 -9.9755 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.9815 -12.8418 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.2730 -13.2490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2714 -14.0662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5617 -14.4722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5598 -15.2886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2673 -15.6994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9781 -15.2878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9765 -14.4727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5519 -13.8881 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.8553 -14.0614 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
6 7 1 0
6 11 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
9 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
16 18 1 0
18 19 3 0
14 20 1 0
20 21 1 0
20 1 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
27 28 1 0
23 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 400.43Molecular Weight (Monoisotopic): 400.1823AlogP: 2.81#Rotatable Bonds: 5Polar Surface Area: 78.17Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.58CX LogP: 5.01CX LogD: 5.01Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.76Np Likeness Score: -1.60