The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-(6-methylquinazolin-4-yl)piperidin-1-yl)(4-(trifluoromethoxy)phenyl)methanone ID: ALA4520598
PubChem CID: 139466427
Max Phase: Preclinical
Molecular Formula: C22H20F3N3O2
Molecular Weight: 415.42
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2ncnc(C3CCN(C(=O)c4ccc(OC(F)(F)F)cc4)CC3)c2c1
Standard InChI: InChI=1S/C22H20F3N3O2/c1-14-2-7-19-18(12-14)20(27-13-26-19)15-8-10-28(11-9-15)21(29)16-3-5-17(6-4-16)30-22(23,24)25/h2-7,12-13,15H,8-11H2,1H3
Standard InChI Key: ZPUVUSCQVAGXEJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
20.4077 -14.2513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4066 -15.0708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1146 -15.4798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8243 -15.0703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8215 -14.2477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1128 -13.8424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6986 -15.4789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9912 -15.0697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6979 -16.2960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9882 -16.6993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9856 -17.5129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6912 -17.9259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4010 -17.5191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4053 -16.6993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5276 -13.8364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5245 -13.0192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2307 -12.6080 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.8153 -12.6133 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.5182 -12.2001 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.6875 -18.7431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6787 -20.3745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3907 -19.9647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3912 -19.1496 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9724 -19.9618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9784 -19.1464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2764 -18.7352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5679 -19.1384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5657 -19.9569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2683 -20.3644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8620 -18.7266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
5 15 1 0
15 16 1 0
16 17 1 0
16 18 1 0
16 19 1 0
12 20 1 0
20 25 2 0
24 21 2 0
21 22 1 0
22 23 2 0
23 20 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 415.42Molecular Weight (Monoisotopic): 415.1508AlogP: 4.86#Rotatable Bonds: 3Polar Surface Area: 55.32Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.79CX LogP: 5.07CX LogD: 5.07Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.61Np Likeness Score: -1.34
References 1. Nguyen D, Lemos C, Wortmann L, Eis K, Holton SJ, Boemer U, Moosmayer D, Eberspaecher U, Weiske J, Lechner C, Prechtl S, Suelzle D, Siegel F, Prinz F, Lesche R, Nicke B, Nowak-Reppel K, Himmel H, Mumberg D, von Nussbaum F, Nising CF, Bauser M, Haegebarth A.. (2019) Discovery and Characterization of the Potent and Highly Selective (Piperidin-4-yl)pyrido[3,2- d]pyrimidine Based in Vitro Probe BAY-885 for the Kinase ERK5., 62 (2): [PMID:30563338 ] [10.1021/acs.jmedchem.8b01606 ]