The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-((5-chloro-2-((2-methoxy-4-(3-(pyridin-3-ylmethyl)ureido)phenyl)amino)pyrimidin-4-yl)amino)-N-isopropylbenzenesulfonamide ID: ALA4520614
PubChem CID: 155542282
Max Phase: Preclinical
Molecular Formula: C27H29ClN8O4S
Molecular Weight: 597.10
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(NC(=O)NCc2cccnc2)ccc1Nc1ncc(Cl)c(Nc2cccc(S(=O)(=O)NC(C)C)c2)n1
Standard InChI: InChI=1S/C27H29ClN8O4S/c1-17(2)36-41(38,39)21-8-4-7-19(12-21)32-25-22(28)16-30-26(35-25)34-23-10-9-20(13-24(23)40-3)33-27(37)31-15-18-6-5-11-29-14-18/h4-14,16-17,36H,15H2,1-3H3,(H2,31,33,37)(H2,30,32,34,35)
Standard InChI Key: JWQOGDHCQLIRLN-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
44.1985 -16.3314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.6112 -17.0413 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
45.0196 -16.3290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9062 -18.7541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9050 -19.5736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6131 -19.9826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.3227 -19.5732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3199 -18.7505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6113 -18.3452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0261 -18.3392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7353 -18.7452 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.4415 -18.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1507 -18.7398 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.8569 -18.3286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5621 -18.7362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2678 -18.3257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2652 -17.5076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5510 -17.1019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8482 -17.5148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4384 -17.5167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.9769 -18.7319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.9796 -19.5491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9708 -17.0954 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.6806 -17.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6806 -18.3177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.3895 -18.7226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0961 -18.3104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0893 -17.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3798 -17.0878 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.8065 -18.7144 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
41.7935 -17.0743 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.5047 -17.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5065 -18.2930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2169 -18.6954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9220 -18.2806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9123 -17.4593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2014 -17.0606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3276 -17.4421 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
46.0303 -17.0249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.7429 -17.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0204 -16.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
12 20 2 0
16 21 1 0
21 22 1 0
17 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
28 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
36 2 1 0
2 38 1 0
38 39 1 0
39 40 1 0
39 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 597.10Molecular Weight (Monoisotopic): 596.1721AlogP: 5.03#Rotatable Bonds: 11Polar Surface Area: 159.26Molecular Species: NEUTRALHBA: 9HBD: 5#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 3CX Acidic pKa: 10.19CX Basic pKa: 4.82CX LogP: 3.89CX LogD: 3.89Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.16Np Likeness Score: -2.08
References 1. Chen H, Li R, Ning X, Zhao X, Jin Y, Yin Y.. (2019) Synthesis and anti-tumor efficacy of novel 2, 4-diarylaminopyrimidine derivatives bearing N-(3-pyridinylmethyl) urea moiety as anaplastic lymphoma kinase inhibitors., 178 [PMID:31177074 ] [10.1016/j.ejmech.2019.05.060 ]