Methyl-(E)-3-(3-(4-hydroxy-3-(trifluoromethyl)phenyl)-3-oxoprop-1-en-1-yl)benzoate

ID: ALA4520670

PubChem CID: 155542456

Max Phase: Preclinical

Molecular Formula: C18H13F3O4

Molecular Weight: 350.29

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)c1cccc(/C=C/C(=O)c2ccc(O)c(C(F)(F)F)c2)c1

Standard InChI:  InChI=1S/C18H13F3O4/c1-25-17(24)13-4-2-3-11(9-13)5-7-15(22)12-6-8-16(23)14(10-12)18(19,20)21/h2-10,23H,1H3/b7-5+

Standard InChI Key:  IRTWUJOEIWQCHP-FNORWQNLSA-N

Molfile:  

 
     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
   29.6527   -3.9415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6516   -4.7610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3596   -5.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0693   -4.7605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0665   -3.9379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3578   -3.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7776   -5.1680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7789   -5.9852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.4847   -4.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4834   -3.9411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1905   -3.5314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8964   -3.9399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6030   -3.5309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6022   -2.7128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8889   -2.3055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1852   -2.7169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8847   -1.4883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5903   -1.0761    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.1749   -1.0833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.1708   -0.2662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3554   -2.7154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9449   -3.5330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.6465   -2.3089    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   31.0619   -2.3047    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   30.3475   -1.8944    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 15 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
  6 21  1  0
  1 22  1  0
 21 23  1  0
 21 24  1  0
 21 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4520670

    ---

Associated Targets(Human)

U-87 MG (3946 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
P4HB Tchem Protein disulfide-isomerase (716 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A 172 (535 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 350.29Molecular Weight (Monoisotopic): 350.0766AlogP: 4.09#Rotatable Bonds: 4
Polar Surface Area: 63.60Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 6.73CX Basic pKa: CX LogP: 4.47CX LogD: 3.73
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.51Np Likeness Score: -0.12

References

1. Yang S, Shergalis A, Lu D, Kyani A, Liu Z, Ljungman M, Neamati N..  (2019)  Design, Synthesis, and Biological Evaluation of Novel Allosteric Protein Disulfide Isomerase Inhibitors.,  62  (7): [PMID:30759340] [10.1021/acs.jmedchem.8b01951]

Source