(4aR,10aS)-10a-(2,4-difluorophenyl)-6-((3,5-dimethylisoxazol-4-yl)methyl)-9-methoxy-4a,5,10,10a-tetrahydro-4H-[1,3]thiazino[5,4-g]isoquinolin-2-amine

ID: ALA4520734

PubChem CID: 155542315

Max Phase: Preclinical

Molecular Formula: C24H24F2N4O2S

Molecular Weight: 470.55

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ncc(Cc2c(C)noc2C)c2c1C[C@]1(c3ccc(F)cc3F)N=C(N)SC[C@@H]1C2

Standard InChI:  InChI=1S/C24H24F2N4O2S/c1-12-17(13(2)32-30-12)6-14-10-28-22(31-3)19-9-24(20-5-4-16(25)8-21(20)26)15(7-18(14)19)11-33-23(27)29-24/h4-5,8,10,15H,6-7,9,11H2,1-3H3,(H2,27,29)/t15-,24-/m0/s1

Standard InChI Key:  WDOXRAVWGMXDFC-OWJWWREXSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   10.5987  -11.2302    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.5987  -12.0515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3081  -12.4601    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3081  -10.8175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0175  -11.2302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0141  -12.0515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7203  -12.4649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7272  -10.8223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4379  -11.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4316  -12.0538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1360  -12.4683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8430  -12.0622    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.8454  -11.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1445  -10.8347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0061  -12.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2916  -13.2706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2833  -14.0871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9881  -14.5013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7027  -14.0973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7075  -13.2822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0102  -10.4089    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.8875  -12.4653    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1307  -13.2896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8357  -13.7029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1472  -10.0134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8563   -9.6031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4221  -12.8741    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.9812  -15.3226    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.6048   -9.9378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1578   -9.3282    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7515   -8.6150    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9475   -8.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7779  -10.7415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3374   -8.2341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  8  1  0
  6  7  1  0
  7 10  1  0
  9  8  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  6 15  1  1
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  5 21  1  1
  2 22  1  0
 11 23  1  0
 23 24  1  0
 14 25  1  0
 25 26  1  0
 20 27  1  0
 18 28  1  0
 26 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  1  0
 32 26  2  0
 29 33  1  0
 32 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4520734

    ---

Associated Targets(Human)

BACE2 Tchem Beta secretase 2 (1716 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BACE1 Tchem Beta-secretase 1 (15641 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 470.55Molecular Weight (Monoisotopic): 470.1588AlogP: 4.24#Rotatable Bonds: 4
Polar Surface Area: 86.53Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.99CX LogP: 4.52CX LogD: 3.84
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.61Np Likeness Score: -0.66

References

1. Blass BE..  (2019)  Tricyclic Inhibitors of β-Secretase and Their Methods of Use for the Treatment of Alzheimer's Disease.,  10  (1): [PMID:30655936] [10.1021/acsmedchemlett.8b00545]

Source