The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 1'-((7-methyl-4-(pyrimidin-5-yl)isoquinolin-3-yl)methyl)-2'-oxospiro[azetidine-3,3'-indoline]-1-carboxylate ID: ALA4520739
PubChem CID: 134298364
Max Phase: Preclinical
Molecular Formula: C27H23N5O3
Molecular Weight: 465.51
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)N1CC2(C1)C(=O)N(Cc1ncc3cc(C)ccc3c1-c1cncnc1)c1ccccc12
Standard InChI: InChI=1S/C27H23N5O3/c1-17-7-8-20-18(9-17)12-30-22(24(20)19-10-28-16-29-11-19)13-32-23-6-4-3-5-21(23)27(25(32)33)14-31(15-27)26(34)35-2/h3-12,16H,13-15H2,1-2H3
Standard InChI Key: ZZZOKDMAKWPSMB-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
26.7403 -5.6644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3181 -5.0784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7362 -4.5005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1542 -5.0825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5881 -5.8482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5870 -6.6719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2991 -7.0850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2974 -5.4394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0101 -5.8446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0109 -6.6678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7235 -7.0790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4359 -6.6640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4312 -5.8378 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.7179 -5.4344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7243 -7.8970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0116 -8.3065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0130 -9.1270 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.7262 -9.5391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4395 -9.1205 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4347 -8.3013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8803 -5.4398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1493 -7.0740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8596 -6.6585 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.9399 -5.8390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1540 -6.3762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6094 -6.9841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8604 -7.7597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6597 -7.9285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2075 -7.3156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9496 -6.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3250 -5.2961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7333 -3.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4436 -3.2640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.0200 -3.2690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1528 -3.6742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 1 1 0
5 6 2 0
6 7 1 0
7 10 2 0
9 8 2 0
8 5 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
11 15 1 0
5 21 1 0
12 22 1 0
22 23 1 0
23 26 1 0
25 1 1 0
1 24 1 0
24 23 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
24 31 2 0
3 32 1 0
32 33 1 0
32 34 2 0
33 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.51Molecular Weight (Monoisotopic): 465.1801AlogP: 3.87#Rotatable Bonds: 3Polar Surface Area: 88.52Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.96CX LogP: 2.36CX LogD: 2.36Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.46Np Likeness Score: -0.54
References 1. Cockerill GS, Good JAD, Mathews N.. (2019) State of the Art in Respiratory Syncytial Virus Drug Discovery and Development., 62 (7): [PMID:30411898 ] [10.1021/acs.jmedchem.8b01361 ]