methyl 1'-((7-methyl-4-(pyrimidin-5-yl)isoquinolin-3-yl)methyl)-2'-oxospiro[azetidine-3,3'-indoline]-1-carboxylate

ID: ALA4520739

PubChem CID: 134298364

Max Phase: Preclinical

Molecular Formula: C27H23N5O3

Molecular Weight: 465.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)N1CC2(C1)C(=O)N(Cc1ncc3cc(C)ccc3c1-c1cncnc1)c1ccccc12

Standard InChI:  InChI=1S/C27H23N5O3/c1-17-7-8-20-18(9-17)12-30-22(24(20)19-10-28-16-29-11-19)13-32-23-6-4-3-5-21(23)27(25(32)33)14-31(15-27)26(34)35-2/h3-12,16H,13-15H2,1-2H3

Standard InChI Key:  ZZZOKDMAKWPSMB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
   26.7403   -5.6644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3181   -5.0784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7362   -4.5005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.1542   -5.0825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5881   -5.8482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5870   -6.6719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2991   -7.0850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2974   -5.4394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0101   -5.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0109   -6.6678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7235   -7.0790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4359   -6.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4312   -5.8378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.7179   -5.4344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7243   -7.8970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0116   -8.3065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0130   -9.1270    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.7262   -9.5391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4395   -9.1205    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.4347   -8.3013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8803   -5.4398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1493   -7.0740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8596   -6.6585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.9399   -5.8390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1540   -6.3762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6094   -6.9841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8604   -7.7597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6597   -7.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2075   -7.3156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9496   -6.5424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3250   -5.2961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7333   -3.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4436   -3.2640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0200   -3.2690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.1528   -3.6742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  1  1  0
  5  6  2  0
  6  7  1  0
  7 10  2  0
  9  8  2  0
  8  5  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 11 15  1  0
  5 21  1  0
 12 22  1  0
 22 23  1  0
 23 26  1  0
 25  1  1  0
  1 24  1  0
 24 23  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 24 31  2  0
  3 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4520739

    ---

Associated Targets(non-human)

Respiratory syncytial virus (3434 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 465.51Molecular Weight (Monoisotopic): 465.1801AlogP: 3.87#Rotatable Bonds: 3
Polar Surface Area: 88.52Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.96CX LogP: 2.36CX LogD: 2.36
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.46Np Likeness Score: -0.54

References

1. Cockerill GS, Good JAD, Mathews N..  (2019)  State of the Art in Respiratory Syncytial Virus Drug Discovery and Development.,  62  (7): [PMID:30411898] [10.1021/acs.jmedchem.8b01361]

Source