The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-Chloro-2-propoxybenzyl)-N-(4-(N-(prop-2-yn-1-yl)sulfamoyl)phenethyl)-2-(pyridin-4-yl)acetamide ID: ALA4520880
PubChem CID: 155542532
Max Phase: Preclinical
Molecular Formula: C28H30ClN3O4S
Molecular Weight: 540.09
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CCNS(=O)(=O)c1ccc(CCN(Cc2cc(Cl)ccc2OCCC)C(=O)Cc2ccncc2)cc1
Standard InChI: InChI=1S/C28H30ClN3O4S/c1-3-14-31-37(34,35)26-8-5-22(6-9-26)13-17-32(28(33)19-23-11-15-30-16-12-23)21-24-20-25(29)7-10-27(24)36-18-4-2/h1,5-12,15-16,20,31H,4,13-14,17-19,21H2,2H3
Standard InChI Key: CZBGORNBMHIXKZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
36.7488 -7.4703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.3444 -6.7604 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
35.9313 -7.4677 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6341 -5.5405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9246 -5.1273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2156 -5.5377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2149 -6.3571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9291 -6.7643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6352 -6.3556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5041 -5.1245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7919 -5.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0845 -5.1234 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.3724 -5.5355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6609 -5.1223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6650 -4.3012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9543 -3.8921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2412 -4.3002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2432 -5.1258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9545 -5.5353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9572 -6.3566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.0589 -6.3521 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0605 -5.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7732 -5.1195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4782 -4.7050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9553 -3.0750 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
30.6663 -6.7628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6690 -7.5800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3781 -7.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0862 -4.3062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7947 -3.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7964 -3.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3793 -3.8962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5054 -2.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5074 -1.8628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8000 -1.4519 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.0891 -1.8635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0906 -2.6786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
6 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
19 20 1 0
9 2 1 0
2 21 1 0
21 22 1 0
22 23 1 0
23 24 3 0
16 25 1 0
20 26 1 0
26 27 1 0
27 28 1 0
12 29 1 0
29 30 1 0
30 31 1 0
29 32 2 0
31 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 540.09Molecular Weight (Monoisotopic): 539.1646AlogP: 4.25#Rotatable Bonds: 13Polar Surface Area: 88.60Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.13CX Basic pKa: 5.04CX LogP: 4.15CX LogD: 4.15Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.33Np Likeness Score: -1.70
References 1. Jiang Y, He L, Green J, Blevins H, Guo C, Patel SH, Halquist MS, McRae M, Venitz J, Wang XY, Zhang S.. (2019) Discovery of Second-Generation NLRP3 Inflammasome Inhibitors: Design, Synthesis, and Biological Characterization., 62 (21): [PMID:31626545 ] [10.1021/acs.jmedchem.9b01155 ]