(1-(3-Aminophenyl)-4-(3-nitrophenyl)-1H-pyrrol-3-yl)(3,4,5-trimethoxyphenyl)-methanone

ID: ALA4520914

PubChem CID: 155542443

Max Phase: Preclinical

Molecular Formula: C26H23N3O6

Molecular Weight: 473.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(C(=O)c2cn(-c3cccc(N)c3)cc2-c2cccc([N+](=O)[O-])c2)cc(OC)c1OC

Standard InChI:  InChI=1S/C26H23N3O6/c1-33-23-11-17(12-24(34-2)26(23)35-3)25(30)22-15-28(19-8-5-7-18(27)13-19)14-21(22)16-6-4-9-20(10-16)29(31)32/h4-15H,27H2,1-3H3

Standard InChI Key:  KVUCSVGIGYUXJF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   36.3157  -20.2467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1311  -20.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5380  -19.5433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1307  -18.8372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3121  -18.8400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9089  -19.5451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0917  -19.5475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6810  -18.8411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.6852  -20.2565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2766  -21.5152    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.9396  -21.0373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8680  -20.2565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6137  -21.0373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4553  -19.5466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8667  -18.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4547  -18.1252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6326  -18.1272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2243  -18.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6387  -19.5511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2759  -22.3312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5666  -22.7392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5662  -23.5556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2745  -23.9650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9846  -23.5520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9814  -22.7369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5392  -20.9558    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.3552  -19.5435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.5381  -18.1289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.3553  -18.1276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1300  -21.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7636  -20.2513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6937  -23.9581    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.4047  -18.8524    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.0007  -19.5628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9914  -18.1474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
 12 13  2  0
 11  9  2  0
 10 11  1  0
  9 12  1  0
 13 10  1  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 10 20  1  0
  2 26  1  0
  3 27  1  0
  4 28  1  0
 28 29  1  0
 26 30  1  0
 27 31  1  0
 24 32  1  0
 33 34  2  0
 33 35  1  0
 18 33  1  0
M  CHG  2  33   1  35  -1
M  END

Alternative Forms

  1. Parent:

    ALA4520914

    ---

Associated Targets(Human)

TUBB4B Tclin Tubulin (5180 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 473.49Molecular Weight (Monoisotopic): 473.1587AlogP: 4.89#Rotatable Bonds: 8
Polar Surface Area: 118.85Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.33CX LogP: 4.68CX LogD: 4.68
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.17Np Likeness Score: -0.70

References

1. Puxeddu M, Shen H, Bai R, Coluccia A, Nalli M, Mazzoccoli C, Da Pozzo E, Cavallini C, Martini C, Orlando V, Biagioni S, Mazzoni C, Coluccia AML, Hamel E, Liu T, Silvestri R, La Regina G..  (2020)  Structure-activity relationship studies and in vitro and in vivo anticancer activity of novel 3-aroyl-1,4-diarylpyrroles against solid tumors and hematological malignancies.,  185  [PMID:31727471] [10.1016/j.ejmech.2019.111828]

Source