The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[4-(1-Cyclobutylpiperidin-4-yloxy)phenyl]-2-(1,1-dioxo-1-thiomorpholin-4-yl)acetamide dihydrochloride ID: ALA4520938
PubChem CID: 155542570
Max Phase: Preclinical
Molecular Formula: C21H33Cl2N3O4S
Molecular Weight: 421.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cl.Cl.O=C(CN1CCS(=O)(=O)CC1)Nc1ccc(OC2CCN(C3CCC3)CC2)cc1
Standard InChI: InChI=1S/C21H31N3O4S.2ClH/c25-21(16-23-12-14-29(26,27)15-13-23)22-17-4-6-19(7-5-17)28-20-8-10-24(11-9-20)18-2-1-3-18;;/h4-7,18,20H,1-3,8-16H2,(H,22,25);2*1H
Standard InChI Key: UOLGHEFPYJBKJA-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
8.5152 -11.1964 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.5457 -7.6916 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1374 -8.4082 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.9622 -8.4036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4235 -8.4082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4223 -9.2355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1372 -9.6484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8536 -9.2351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8507 -8.4046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1354 -7.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7090 -7.9959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9946 -8.4085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2758 -7.9931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5636 -8.4022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5596 -9.2276 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2739 -9.6421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9924 -9.2313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5687 -9.6465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2825 -9.2329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9976 -9.6442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2813 -8.4079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7115 -9.2306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8444 -9.6354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0483 -9.4191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8319 -10.2152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6280 -10.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4232 -9.6464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1348 -9.2362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4229 -7.9974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7049 -8.4091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8598 -11.0786 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
4 3 2 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
5 11 1 0
11 12 1 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
8 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 23 1 0
15 23 1 0
22 27 1 0
22 30 1 0
27 28 1 0
28 3 1 0
3 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 421.56Molecular Weight (Monoisotopic): 421.2035AlogP: 1.75#Rotatable Bonds: 6Polar Surface Area: 78.95Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.97CX Basic pKa: 9.11CX LogP: 0.54CX LogD: -1.17Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.75Np Likeness Score: -1.53
References 1. Nirogi R, Shinde A, Mohammed AR, Badange RK, Reballi V, Bandyala TR, Saraf SK, Bojja K, Manchineella S, Achanta PK, Kandukuri KK, Subramanian R, Benade V, Palacharla RC, Jayarajan P, Pandey S, Jasti V.. (2019) Discovery and Development of N-[4-(1-Cyclobutylpiperidin-4-yloxy)phenyl]-2-(morpholin-4-yl)acetamide Dihydrochloride (SUVN-G3031): A Novel, Potent, Selective, and Orally Active Histamine H3 Receptor Inverse Agonist with Robust Wake-Promoting Activity., 62 (3): [PMID:30629436 ] [10.1021/acs.jmedchem.8b01280 ]