The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
29-norlupan-3,20-dione ID: ALA4520942
PubChem CID: 155542326
Max Phase: Preclinical
Molecular Formula: C29H46O2
Molecular Weight: 426.69
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)[C@@H]1CC[C@]2(C)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12
Standard InChI: InChI=1S/C29H46O2/c1-18(30)19-10-13-26(4)16-17-28(6)20(24(19)26)8-9-22-27(5)14-12-23(31)25(2,3)21(27)11-15-29(22,28)7/h19-22,24H,8-17H2,1-7H3/t19-,20+,21-,22+,24+,26+,27-,28+,29+/m0/s1
Standard InChI Key: KBNLDLGROQKYEQ-XFPNZXGSSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
23.6686 -6.2258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6591 -7.0526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9559 -7.4525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2449 -7.0449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5358 -7.4601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5417 -8.2793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8308 -8.6791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1275 -8.2793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1275 -7.4601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8308 -7.0449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4153 -8.6870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4114 -9.3883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2306 -9.3883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2449 -8.6791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9559 -8.2716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5358 -9.0908 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
21.5358 -6.6410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2449 -6.2199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9559 -5.8082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2449 -7.8600 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
22.9500 -6.6333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3641 -7.4601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0828 -7.0544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0828 -6.2352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3777 -5.8141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3777 -6.6333 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
24.5603 -5.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3812 -4.9363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7040 -5.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9804 -4.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1885 -4.6459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1925 -3.6418 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.7842 -6.6469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6591 -7.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6686 -5.4063 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
3 4 1 0
5 4 1 0
6 5 1 0
7 6 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 5 1 0
8 11 2 0
12 7 1 0
13 7 1 0
6 14 1 0
14 15 1 0
15 3 1 0
6 16 1 6
5 17 1 1
4 18 1 0
18 19 1 0
19 1 1 0
4 20 1 6
3 21 1 1
22 2 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 1 1 0
25 26 1 6
25 27 1 0
27 28 1 0
28 29 1 0
24 29 1 0
27 30 1 6
30 31 1 0
30 32 2 0
24 33 1 1
2 34 1 6
1 35 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.69Molecular Weight (Monoisotopic): 426.3498AlogP: 7.25#Rotatable Bonds: 1Polar Surface Area: 34.14Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.89CX LogD: 6.89Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.44Np Likeness Score: 2.91