29-norlupan-3,20-dione

ID: ALA4520942

PubChem CID: 155542326

Max Phase: Preclinical

Molecular Formula: C29H46O2

Molecular Weight: 426.69

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)[C@@H]1CC[C@]2(C)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12

Standard InChI:  InChI=1S/C29H46O2/c1-18(30)19-10-13-26(4)16-17-28(6)20(24(19)26)8-9-22-27(5)14-12-23(31)25(2,3)21(27)11-15-29(22,28)7/h19-22,24H,8-17H2,1-7H3/t19-,20+,21-,22+,24+,26+,27-,28+,29+/m0/s1

Standard InChI Key:  KBNLDLGROQKYEQ-XFPNZXGSSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   23.6686   -6.2258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6591   -7.0526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9559   -7.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2449   -7.0449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5358   -7.4601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5417   -8.2793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8308   -8.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1275   -8.2793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1275   -7.4601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8308   -7.0449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4153   -8.6870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4114   -9.3883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2306   -9.3883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2449   -8.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9559   -8.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5358   -9.0908    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   21.5358   -6.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2449   -6.2199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9559   -5.8082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2449   -7.8600    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   22.9500   -6.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3641   -7.4601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0828   -7.0544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0828   -6.2352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3777   -5.8141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3777   -6.6333    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   24.5603   -5.0136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3812   -4.9363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7040   -5.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9804   -4.4338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1885   -4.6459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1925   -3.6418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.7842   -6.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6591   -7.8677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6686   -5.4063    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  3  4  1  0
  5  4  1  0
  6  5  1  0
  7  6  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10  5  1  0
  8 11  2  0
 12  7  1  0
 13  7  1  0
  6 14  1  0
 14 15  1  0
 15  3  1  0
  6 16  1  6
  5 17  1  1
  4 18  1  0
 18 19  1  0
 19  1  1  0
  4 20  1  6
  3 21  1  1
 22  2  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25  1  1  0
 25 26  1  6
 25 27  1  0
 27 28  1  0
 28 29  1  0
 24 29  1  0
 27 30  1  6
 30 31  1  0
 30 32  2  0
 24 33  1  1
  2 34  1  6
  1 35  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4520942

    ---

Associated Targets(non-human)

Toxoplasma gondii (4585 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 426.69Molecular Weight (Monoisotopic): 426.3498AlogP: 7.25#Rotatable Bonds: 1
Polar Surface Area: 34.14Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.89CX LogD: 6.89
Aromatic Rings: Heavy Atoms: 31QED Weighted: 0.44Np Likeness Score: 2.91

References

1. Deng Y, Wu T, Zhai SQ, Li CH..  (2019)  Recent progress on anti-Toxoplasma drugs discovery: Design, synthesis and screening.,  183  [PMID:31585276] [10.1016/j.ejmech.2019.111711]

Source