The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-amino-5-fluorophenyl)-4-(((3-ethyl-7-methoxy-4-oxo-3,4-dihydroquinazolin-2-yl)thio)methyl)benzamide ID: ALA4521002
PubChem CID: 155542583
Max Phase: Preclinical
Molecular Formula: C25H23FN4O3S
Molecular Weight: 478.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCn1c(SCc2ccc(C(=O)Nc3cc(F)ccc3N)cc2)nc2cc(OC)ccc2c1=O
Standard InChI: InChI=1S/C25H23FN4O3S/c1-3-30-24(32)19-10-9-18(33-2)13-21(19)29-25(30)34-14-15-4-6-16(7-5-15)23(31)28-22-12-17(26)8-11-20(22)27/h4-13H,3,14,27H2,1-2H3,(H,28,31)
Standard InChI Key: ZSILZBVZUCXWIE-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
16.7881 -3.8713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7870 -4.6908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4950 -5.0998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4933 -3.4624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2019 -3.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2052 -4.6883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9137 -5.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6233 -4.6825 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6200 -3.8619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9070 -3.4522 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9159 -5.9107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3264 -3.4511 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.0354 -3.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7418 -3.4467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4501 -3.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1561 -3.4453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1540 -2.6273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4400 -2.2211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7370 -2.6335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8599 -2.2156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5694 -2.6210 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8563 -1.3984 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2753 -2.2093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9832 -2.6172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6886 -2.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6855 -1.3881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9710 -0.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2685 -1.3962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9852 -3.4344 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0803 -3.4629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3727 -3.8716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3321 -5.0892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3344 -5.9064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9645 -0.1657 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
7 11 2 0
9 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
24 29 1 0
1 30 1 0
30 31 1 0
8 32 1 0
32 33 1 0
27 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.55Molecular Weight (Monoisotopic): 478.1475AlogP: 4.69#Rotatable Bonds: 7Polar Surface Area: 99.24Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.32CX LogP: 4.60CX LogD: 4.60Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.23Np Likeness Score: -1.84
References 1. Cheng C, Yun F, He J, Ullah S, Yuan Q.. (2019) Design, synthesis and biological evaluation of novel thioquinazolinone-based 2-aminobenzamide derivatives as potent histone deacetylase (HDAC) inhibitors., 173 [PMID:31003060 ] [10.1016/j.ejmech.2019.04.017 ]