(E)-3-((2-chloro-6-methoxy-4-((3-oxobenzo[d]thiazolo[3,2-a]imidazol-2(3H)-ylidene)methyl)phenoxy)methyl)benzoic acid

ID: ALA4521019

PubChem CID: 1000640

Max Phase: Preclinical

Molecular Formula: C25H17ClN2O5S

Molecular Weight: 492.94

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(/C=c2/sc3nc4ccccc4n3c2=O)cc(Cl)c1OCc1cccc(C(=O)O)c1

Standard InChI:  InChI=1S/C25H17ClN2O5S/c1-32-20-11-15(10-17(26)22(20)33-13-14-5-4-6-16(9-14)24(30)31)12-21-23(29)28-19-8-3-2-7-18(19)27-25(28)34-21/h2-12H,13H2,1H3,(H,30,31)/b21-12+

Standard InChI Key:  ARGGFLYGOMIFDV-CIAFOILYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   30.3764  -10.4670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0508  -10.0054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8177  -10.2823    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.0709   -9.1912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8549   -8.9605    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3143   -9.6361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0988   -9.4079    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3554   -8.3149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1274   -8.5941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7531   -8.0655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6080   -7.2577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8317   -6.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2093   -7.5116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4227   -8.6936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.6395  -10.1137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5817   -9.2995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8457   -8.9462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1703   -9.4079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2358  -10.2267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9721  -10.5762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5630  -10.6906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.8249  -10.3399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7835   -8.1314    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   27.4329   -9.0556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7592   -9.5180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0218   -9.1657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9608   -8.3530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2243   -8.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5495   -8.4633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6161   -9.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3529   -9.6306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9421   -9.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2035   -9.3981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0085  -10.5623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  4  2  1  0
  5  6  1  0
  6  7  2  0
  7  9  1  0
  8  5  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  4 14  2  0
  1 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 19 21  1  0
 21 22  1  0
 17 23  1  0
 18 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 32 33  1  0
 32 34  2  0
 30 32  1  0
M  END

Associated Targets(Human)

PTPN5 Tchem Tyrosine-protein phosphatase non-receptor type 5 (536 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 492.94Molecular Weight (Monoisotopic): 492.0547AlogP: 4.40#Rotatable Bonds: 6
Polar Surface Area: 90.13Molecular Species: ACIDHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 4.02CX Basic pKa: CX LogP: 5.35CX LogD: 2.20
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.38Np Likeness Score: -1.31

References

1. Ge L, Li KS, Li MM, Xiao P, Hou XB, Chen X, Liu HD, Lin A, Yu X, Ren GJ, Fang H, Sun JP..  (2016)  Identification of a benzo imidazole thiazole derivative as the specific irreversible inhibitor of protein tyrosine phosphatase.,  26  (19): [PMID:27554446] [10.1016/j.bmcl.2016.08.024]

Source