The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-3-((2-chloro-6-methoxy-4-((3-oxobenzo[d]thiazolo[3,2-a]imidazol-2(3H)-ylidene)methyl)phenoxy)methyl)benzoic acid ID: ALA4521019
PubChem CID: 1000640
Max Phase: Preclinical
Molecular Formula: C25H17ClN2O5S
Molecular Weight: 492.94
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=c2/sc3nc4ccccc4n3c2=O)cc(Cl)c1OCc1cccc(C(=O)O)c1
Standard InChI: InChI=1S/C25H17ClN2O5S/c1-32-20-11-15(10-17(26)22(20)33-13-14-5-4-6-16(9-14)24(30)31)12-21-23(29)28-19-8-3-2-7-18(19)27-25(28)34-21/h2-12H,13H2,1H3,(H,30,31)/b21-12+
Standard InChI Key: ARGGFLYGOMIFDV-CIAFOILYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
30.3764 -10.4670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0508 -10.0054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8177 -10.2823 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.0709 -9.1912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8549 -8.9605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3143 -9.6361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0988 -9.4079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3554 -8.3149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1274 -8.5941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7531 -8.0655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6080 -7.2577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8317 -6.9812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2093 -7.5116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4227 -8.6936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6395 -10.1137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5817 -9.2995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8457 -8.9462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1703 -9.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2358 -10.2267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9721 -10.5762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5630 -10.6906 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8249 -10.3399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7835 -8.1314 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
27.4329 -9.0556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7592 -9.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0218 -9.1657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9608 -8.3530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2243 -8.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5495 -8.4633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6161 -9.2821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3529 -9.6306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9421 -9.7478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2035 -9.3981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0085 -10.5623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 1 0
5 4 1 0
4 2 1 0
5 6 1 0
6 7 2 0
7 9 1 0
8 5 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
4 14 2 0
1 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
19 21 1 0
21 22 1 0
17 23 1 0
18 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
32 33 1 0
32 34 2 0
30 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.94Molecular Weight (Monoisotopic): 492.0547AlogP: 4.40#Rotatable Bonds: 6Polar Surface Area: 90.13Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.02CX Basic pKa: ┄CX LogP: 5.35CX LogD: 2.20Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.38Np Likeness Score: -1.31
References 1. Ge L, Li KS, Li MM, Xiao P, Hou XB, Chen X, Liu HD, Lin A, Yu X, Ren GJ, Fang H, Sun JP.. (2016) Identification of a benzo imidazole thiazole derivative as the specific irreversible inhibitor of protein tyrosine phosphatase., 26 (19): [PMID:27554446 ] [10.1016/j.bmcl.2016.08.024 ]