The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{[6-(4-Bromophenyl)-2-ethylimidazo[2,1-b][1,3,4]thiadiazol-5-ylmethylene]hydrazono}-4-methyl-2,3-dihydrothiazole-5-carboxylic acid ethyl ester ID: ALA4521107
PubChem CID: 155542459
Max Phase: Preclinical
Molecular Formula: C20H19BrN6O2S2
Molecular Weight: 519.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1s/c(=N\N=C\c2c(-c3ccc(Br)cc3)nc3sc(CC)nn23)[nH]c1C
Standard InChI: InChI=1S/C20H19BrN6O2S2/c1-4-15-26-27-14(16(24-20(27)30-15)12-6-8-13(21)9-7-12)10-22-25-19-23-11(3)17(31-19)18(28)29-5-2/h6-10H,4-5H2,1-3H3,(H,23,25)/b22-10+
Standard InChI Key: OVMFREODPGKQFU-LSHDLFTRSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
21.8058 -6.2832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7874 -4.9421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3155 -5.6194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5799 -5.1870 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.5891 -6.0141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3789 -6.2639 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.8593 -5.5885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3640 -4.9239 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4932 -5.6320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0683 -4.9192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2420 -4.9304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8397 -5.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2655 -6.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0904 -6.3521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5214 -4.1592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7098 -4.0002 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4437 -3.2173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6366 -3.0570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2908 -2.3129 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4735 -2.4099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3132 -3.2170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0314 -3.6188 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.6823 -5.5793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1016 -6.2874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9165 -1.8081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5660 -3.5618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8938 -3.0872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4910 -4.3814 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1466 -3.4320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4744 -2.9573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0168 -5.6659 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 5 2 0
4 2 1 0
2 3 2 0
3 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
3 9 1 0
2 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 18 1 0
7 23 1 0
23 24 1 0
20 25 1 0
21 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
29 30 1 0
12 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.45Molecular Weight (Monoisotopic): 518.0194AlogP: 4.59#Rotatable Bonds: 6Polar Surface Area: 97.00Molecular Species: ACIDHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.46CX Basic pKa: 2.33CX LogP: 5.23CX LogD: 4.49Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.23Np Likeness Score: -1.93
References 1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R.. (2019) Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents., 174 [PMID:31051403 ] [10.1016/j.ejmech.2019.04.052 ]