The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,5-difluoro-N-{3-fluoro-4-[6-methoxy-7-(3-morpholin-4-yl-propoxy)-quinolin-4-yloxy]-phenyl}-benzenesulfonamide ID: ALA4521196
PubChem CID: 58229387
Max Phase: Preclinical
Molecular Formula: C29H28F3N3O6S
Molecular Weight: 603.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(Oc3ccc(NS(=O)(=O)c4cc(F)ccc4F)cc3F)ccnc2cc1OCCCN1CCOCC1
Standard InChI: InChI=1S/C29H28F3N3O6S/c1-38-27-17-21-24(18-28(27)40-12-2-9-35-10-13-39-14-11-35)33-8-7-25(21)41-26-6-4-20(16-23(26)32)34-42(36,37)29-15-19(30)3-5-22(29)31/h3-8,15-18,34H,2,9-14H2,1H3
Standard InChI Key: UDOVMPNKTGYWHU-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
24.1195 -11.9896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7151 -11.2838 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.3061 -11.9870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0758 -13.7601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0747 -14.5797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7827 -14.9886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7810 -13.3513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4896 -13.7565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4903 -14.5756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1989 -14.9826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9071 -14.5718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9024 -13.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1933 -13.3463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1890 -12.5291 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8945 -12.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5998 -12.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3048 -12.1133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3009 -11.2953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5861 -10.8906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8840 -11.3046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0059 -10.8820 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4213 -10.8726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1286 -11.2812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8343 -10.8707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8318 -10.0526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1175 -9.6468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4147 -10.0596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1718 -10.9039 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.3667 -14.9877 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3680 -13.3517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6604 -13.7605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6593 -14.5786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7038 -9.6566 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.5433 -11.2770 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.9513 -14.9866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2439 -14.5774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5358 -14.9855 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8342 -14.5725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1283 -14.9770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1234 -15.7946 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8306 -16.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5427 -15.7997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
21 2 1 0
2 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
20 28 1 0
5 29 1 0
4 30 1 0
30 31 1 0
29 32 1 0
27 33 1 0
24 34 1 0
32 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
37 42 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 603.62Molecular Weight (Monoisotopic): 603.1651AlogP: 5.35#Rotatable Bonds: 11Polar Surface Area: 99.22Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.41CX Basic pKa: 7.03CX LogP: 3.39CX LogD: 3.33Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.23Np Likeness Score: -1.68
References 1. Szabadkai I, Torka R, Garamvölgyi R, Baska F, Gyulavári P, Boros S, Illyés E, Choidas A, Ullrich A, Őrfi L.. (2018) Discovery of N-[4-(Quinolin-4-yloxy)phenyl]benzenesulfonamides as Novel AXL Kinase Inhibitors., 61 (14): [PMID:29928803 ] [10.1021/acs.jmedchem.8b00672 ]